loading

Logout succeed

Logout succeed. See you again!

ebook img

Judgment PDF

file size0.21 MB

Preview Judgment

Judgment Ruadhan O’Flanagan1 Abstract 8 0 The concept of a judgment as a logical action which introduces new in- 0 formation into a deductive system is examined. This leads to a way of 2 mathematically representingimplication whichisdistinct from thefamil- iar material implication, according to which “If A then B” is considered n to be equivalent to “B or not-A”. This leads, in turn, to a resolution of a J the paradox of theraven. 8 1 1 Introduction ] R Thisnoteexaminestherelationshipbetweenthetheoryofquantificationofinfor- P mationandthe conceptofjudgment, whichis the actionwherebyaproposition h. which provides information is given. t The information presented here is intended to be self-contained, but the a interested reader can consult references [1, 2, 3] for background information m regarding information, [4, 5] for probability, [6, 7, 8] for evidence, [9, 10] for [ judgment and [11, 12, 13, 14, 15, 16] for the paradox of the raven, also called 3 theravenparadoxortheparadoxofconfirmation. Onafirstreading,thereader v may find it advisable to skip mathematical proofs which appear laborious; the 2 text should remain largely comprehensible. 0 Section 2 introduces the concept of a judgment in terms of its relation to 4 4 probability. The central point to understand is that a judgment involves a . changeinwhatisthoughttobetrueratherthanmerelyastatementthatsome- 2 1 thing is true, or an assertion. 7 Consideringjudgmentsinsteadofstatementsmakesitnecessarytotakeinto 0 account the distinction between the subject and the predicate. For example, : v “John is taller than Mary” and “Mary is shorter than John” express the same i relation between John and Mary when the sentences are interpreted as mere X statementsoffact. ItmakesnodifferencewhetherJohnorMaryisconsideredto r bethesubject,becauseonepropositionistrueifandonlyiftheotherproposition a is. Iftheyareinterpretedasjudgments,though,theyproducedifferentchanges: Inthejudgmentthat“JohnistallerthanMary,”Johnisthesubjectand“taller than Mary” is the predicate. Mary is used only for reference, so if we are incorporating this new information about John into what we already know, then we will increase our estimate of John’s height without changing what we think about Mary. 1Sloan-Swartz Centre for Theoretical Neurobiology, Salk Institute, 10010 North Torrey PinesRoad,CA92037. ofl[email protected] 1 Conversely, in the proposition that “Mary is shorter than John”, Mary is understood to be the subject, so when this judgment is passed, it is what is believed about Mary that changes. Sections 3 and4 introduce the quantities ofinformationandevidencein the contextofjudgment. Theamountofinformationgivenwhenajudgmentoccurs measures how much the judgment can accomplish, that is, what changes in the probabilities of propositions can be effected by the judgment. Evidence accumulated in favour of a proposition inclines one towards the judgment throughwhich thatpropositionwouldbe given;onecanset a thresh- oldforevidenceandpassthejudgmentthatapropositionistrueiftheevidence in favour of that proposition exceeds the threshold. It is also shown in section 4 that quantities of evidence determine what changes should be made when a proposition of probability zero is given. Section5examinesthevariouswaysinwhichitcanbeestablishedthrougha judgment that one propositionimplies another. The statement that one propo- sition implies another is unambiguous because it refers to a pre-existing state of affairs. If one is to judge that one proposition implies another, however, one must decide what changes to make, and there are several different ways to changetherelationshipbetweenthepropositionssothat,afterthechangeshave been made, the one proposition implies the other. In section 5, the rules relating quantities of information to counterfactuals are examined. In this context, counterfactuals are propositions of the form “If A then B” where P(A)=0. This leads to a considerationof what changes can be effected when a proposition with probability one is given. Finally, section6 explains how distinguishing betweenjudgments and state- ments resolves the paradox of the raven. The paradox arises when one regards “Allravensareblack”and “Allnon-blackthings arenon-ravens”as equivalent, which would lead one to believe that evidence favouring one proposition must also favour the other. The observation of a black raven, then, should provide evidence that “All non-black things are non-ravens”, and the observation of a blue sky, which is a non-black non-raven, should provide evidence that “All ravens are black”, which is absurd. The equivalence between the two propositions disappears when one consid- ers the judgments through which the propositions are given rather than the statements which assert that the propositions are true. The propositions have different subjects and different predicates: the judg- ment that “All ravens are black” changes what we think about ravens, while thejudgmentthat“Allnon-blackthingsarenon-ravens”changeswhatwethink about non-black things. Evidence inclines us towards a judgment, not a state- ment; when we see that the evidence is sufficient to persuade us, we change what we believe, rather than merely stating what we already believed. Section 6 makes this qualitative solution quantitative by explicitly calculat- ing the amounts of evidence provided by the observation of a black raven in favour of the respective propositions. 2 2 Judgment The word “circumstance” is used here to refer to a situation in which certain propositions are given and every proposition can be assigned a probability. A judgment is a logical action which changes the circumstance by giving a new proposition. If A is judged to be true then, after the judgment, the new value of P(B) is equal to the old value of P(B|A). Since the probabilities of propositions depend on the circumstance, an un- ambiguous notation would indicate, for each probability mentioned, what the relevant circumstance was. PC(A) could be used, for example, to denote the probability of A in the circumstance C. Since we will mostly be considering individual judgments here, though, we will drop the C and refer to the values of probabilities before the judgment as the old values and the values after the judgment as the new values. The expressionP(B|A) isreadas“the probabilityofB givenA” butinthis case A is only hypothetically given; it is not actually taken as an axiom in the present circumstance. When the judgment occurs, A is actually given. P(B|A) is more exactly described by the phrase “the probability that B would acquire if A were to be given”. When P(A) 6= 0, P(B|A) = P(BA)/P(A), where BA has been used to denote the proposition B and A. This is not a definition of P(B|A). Since it has already been said that P(B|A) is the probability that B would acquire if A were to be given, we are not free to define P(B|A) again. That P(B|A) = P(BA)/P(A) when P(A)6= 0 is something which must be justified, or proven, instead of chosen. The justification is easily understood when the equation is expressed in terms of information, as it is in the next section. Theinterpretationofprobabilitiesisnotimportanthere. Itisonlynecessary to observe that P(A) = 1 may provisionally be considered as a sufficient proof of the propositionA, but that it is not a logicalimpossibility for P(A) to equal one and for A to be false. For example, if a real number, x, is chosenrandomly from between zero and one, so that the probability that x lies in the interval [c,d) is d−c, then before the value of x is revealed to us, the probability that x = 1/2 is zero, but it is not logically impossible that x = 1/2. There is in any case some number which x equals, and the probability that x equals that number is zero. The inference from P(A)=1 to A is therefore weaker than a perfect proof, andifP(A)=1inaparticularcircumstance,thenitremainsalogicalpossibility that A is false. It should therefore be possible to incorporate the information that A is false without encountering a logical contradiction,although after this information has been incorporated, the probability of A will be zero instead of one. It will be said that a proposition, A, is “believed” when, in a particular circumstance, P(A) = 1, and, correspondingly, that it is not believed when P(A) 6= 1. This word is used because it is weaker than, for example, the word “known”, which would suggest not only that the proposition is believed, but also that it is true. 3 When P(A) = 0, P(B|A) cannot be determined by using the expression P(BA)/P(A). However, all that is necessary for the judgment to occur is that everypropositionB be assigneda probability consistentwith the rules ofprob- ability2, which is enough to specify the new circumstance. For example, the assignment: 0 if y 6= 1 P(x=y|x=1/2)= 2 (cid:26) 1 if y = 1 2 is consistent even though the expression P(x = y and x = 1)/P(x = 1) yields 2 2 0/0. If P(A) = 0, then, the value of P(B|A) is not constrained by the values of probabilities of propositions in the current circumstance, while if P(A) > 0, it is. The inference from P(A) = 1 to A is therefore legitimate insofar as P(A) is guaranteed to equal one in every future circumstance unless a proposition of probability zero is given, after which P(A) may take any value. 3 Information 3.1 Introduction i(B) ≡ −logP(B) is the amount of information which would be provided by the revelation that B is true, since it is zero if B is already believed, one bit if P(B)=1/2, two bits if P(B)=1/4 and so on. Ifwearewillingtosaythatinformationissomethingwhichcanbebelieved, in additionto sayingthat propositions canbe believed, then i(B) canbe called the amount of information which it is necessary to believe in order to believe B. If B implies and is implied by CD and C and D are independent, that is, P(CD) = P(C)P(D), then in order to believe B it is necessary to believe C and also to believe D, and the amount of information which it is necessary to believe in order to believe B is equal to the sum of the amount necessary to believe C and the amount necessary to believe D. It can be seen that i(B) is the minimum amountof informationwhich must be given before P(B) can reach one from the fact that: P(B|A)=1⇒1=P(BA)/P(A)≤P(B)/P(A)⇒i(A)≥i(B) If A implies B but is no less probable than it3, then B also implies A, because: 1=P(B|A)=P(BA)/P(A)=P(BA)/P(B)=P(A|B) This applies only if P(A) 6= 0. We can therefore infer from the truth of the consequence of a proposition to the truth of the proposition itself if the 2Therulesrelatingprobabilitytopropositionsare: P(A or B)=P(A)+P(B)−P(AB), P(AB)+P(AB¯)=P(A)and0≤P(A)≤1,whereB¯ denotes thenegationofB. 3AcannotbemoreprobablethanB ifAimpliesB,soifAisnomoreinformativethanB andimpliesitthen P(A)=P(B). 4 proposition is no less probable, or equivalently, no more informative than the consequence. 3.2 Common Information The amount of information which it is necessary to believe in order to believe a proposition can never be negative, because P(A)≤1⇒i(A)≥0. Ifweconsiderthequantityi(A;B)≡i(A)+i(B)−i(AB),thenthisquantity can be positive or negative. When i(A;B) is positive, less information is required to believe both A and B than the sum of the amounts of information required to believe A and B. This is the condition under which three independent propositions, C, D and E can be known of such that A implies and is implied by CD and B implies and is implied by DE, with i(D) = i(A;B). In that case, i(A;B) could be called the amount of information common to A and B. On the other hand, if the quantity i(A;B) is negative, then in order to believe both A and B it is necessary to believe more than the sum of the amounts necessary to believe A and B individually. When i(A;B) is negative, then, AB implies something additional besides what is implied by A and what is implied by B. The question which naturally arises is whether a proposition, C, canbe knownof,suchthatC is independent ofAandindependentofB but is implied by AB, with P(AB|C) = P(A)P(B), which in this case would be equivalent to i(C)=−i(A;B). ForapropositionsuchasC tostandinthatrelationshiptoAandB,itwould be necessary for P(A)+P(B) to be less than or equal to one. This is because ifC is independentofAandB,then itmustbe possibleto learnthatC isfalse without changing the probabilities of A and B, so P(A)+P(B) = P A|C¯ + P B|C¯ . If C is discovered to be false, however, then AB will be bel(cid:0)ieved(cid:1)to be(cid:0)false(cid:1)and hence the truth of A would imply the falsity of B and vice versa, P AB|C¯ = 0. That is, A and B would be mutually exclusive, and therefore P(cid:0)A|C¯ +(cid:1) P B|C¯ could not exceed one, and neither could P(A)+P(B). (cid:0)Prov(cid:1)ided i(cid:0)(A;B(cid:1))< 0 and P(A)+P(B) ≤ 1, though, a proposition such as C, which A and B jointly imply but are individually independent of, can be known of. C could be called the independent consequence of A and B. It can be seen that: i(A;B)<0 ⇒log P(AB) <0 P(A)P(B) ⇒P(AB)<P(A)P(B) ⇒1−P(A)−P(B)+P(AB)<(1−P(A))(1−P(B)) ⇒P A¯B¯ <P A¯ P B¯ (cid:0) P((cid:1)A¯B¯) (cid:0) (cid:1) (cid:0) (cid:1) ⇒log <0 P(A¯)P(B¯) ⇒i A¯;B¯ <0 (cid:0) (cid:1) where it has been assumedin the second-laststepthat P A¯ >0 andP B¯ > 0. Now either P(A)+P(B)≤1 orP A¯ +P B¯ ≤1 or(cid:0)bot(cid:1)h. Combinin(cid:0)g t(cid:1)his (cid:0) (cid:1) (cid:0) (cid:1) 5 with the result above proves that either A and B or A¯ and B¯ will satisfy the conditions necessary to have an independent consequence. More generally, for any two propositions, A and B, which are not indepen- dent and with probabilities strictly between zero and one, two of the quantities i(A;B), i A¯;B , i A;B¯ and i A¯;B¯ will be negative and two will be posi- tive. Of th(cid:0)e two(cid:1)pai(cid:0)rs of p(cid:1)roposit(cid:0)ions w(cid:1)hich yield negative quantities, it will be possible for at least one pair to have an independent consequence. 3.3 The Justification of P(A|B) = P(AB)/P(B) We can denote the amount of information which it is necessary to believe in ordertobelieveAassumingthatBistrueasi(A|B)≡−logP(A|B). Whenever P(B)6=0, i(A|B) is equalto i(AB)−i(B). This is equivalentto the statement that P(A|B) = P(AB)/P(B) but is more obviously true. The following three expressions clearly all refer to the same quantity: • The amount of information which it is necessary to believe in order to believe that A is true if we can assume that B is true • The amount of information which it is necessary to believe in order to believe that both A and B are true if we can assume that B is true • The amount of information which it is necessary to believe in order to believethatbothAandB aretrueminustheamountnecessarytobelieve B (which has been assumed and therefore does not need to be believed) ThiscanbetakenasajustificationofthestatementthatP(A|B)=P(AB)/P(B) whenever P(B)6=0. i(A|B) is also equal to i(A)−i(A;B). 3.4 How Much a Judgment can Accomplish Foranytwopropositions,AandB,suchthatP(B)6=0,i(A|B)isalwaysgreater than or equal to i(A)−i(B) because logP(AB)/P(B) ≤ logP(A)/P(B). If, when B is given, i(A) decreases to i(A)− i(B), then the judgment through which B is givencan not alter the probability of any proposition which is inde- pendentofAbothbeforeandafterthejudgment. Thisisbecause,ifD issucha propositionandP(D|B)6=P(D),theneitheri(D|B)<i(D)ori(D¯|B)<i(D¯), so either i(AD|B)=i(A|B)+i(D|B)=i(A)−i(B)+i(D|B)<i(AD)−i(B) or i(AD¯|B)=i(A|B)+i(D¯|B)=i(A)−i(B)+i(D¯|B)<i(AD¯)−i(B) either of which would contradictthe statement that the amount of information necessarytobelieveapropositioncandecreasebyatmosti(B)whenB isgiven. Inthissense,ifalloftheinformationgiveninajudgmentiscontainedwithinthe informationrequiredtobelieveaparticularproposition,thenthatjudgmentcan accomplish nothing else, that is, no changes in the probabilities of propositions which are independent of that particular proposition. 6 4 Evidence 4.1 Quantifying Evidence If a coinis biasedso that it lands onone particular side 90%ofthe time, but it is notknownwhichside the coinis biasedin favourof, thenrepetitively tossing the coinandobservingwhichsideitmostfrequentlylandsonprovidesawayto discover which side the bias favours. If H is the hypothesis thatthe biasin favourof heads,andBn is the propo- th sition that the result of the n toss is heads, then: log P(H|B1B2) =logP(B1B2|H) P(B1B2) P(H) P(H¯|B1B2) P(B1B2) P(B1B2|H¯)P(H¯) =log P(H) +log P(B1B2|H) P(H¯) P(B1B2|H¯) If we can assume that H is true, then observing the result of one coin toss doesnotchangetheprobabilitythatthenexttosswillresultinheads;itremains at 90%. Similarly, if we assume that H is false, then the probability that the secondresultwill be heads is 10%,regardlessof whatthe resultof the first toss is. The probabilities P(B B |H) and P B B |H¯ therefore factorize: 1 2 1 2 (cid:0) (cid:1) P(B B |H)=P(B |H)P(B |H) and P(B B |H¯)=P(B |H¯)P(B |H¯) 1 2 1 2 1 2 1 2 leading to: P(H|B B ) P(H) P(B |H) P(B |H) 1 2 1 2 log =log +log +log P H¯|B B P H¯ P B |H¯ P B |H¯ 1 2 1 2 (cid:0) (cid:1) (cid:0) (cid:1) (cid:0) (cid:1) (cid:0) (cid:1) In this way, each occurrence of a heads provides an additional contribution to the logarithm of the odds of H, independent of the contributions provided by the results of the other coin tosses. The quantity whichaccumulatesasmoreoccurrencesofheads areobserved, with each occurrence providing a contribution independent of the others, and suchthat the accumulationof this quantity inclines one towardsthe belief that the bias is in favour of heads, is colloquially called evidence. We will use the notation e(B →H) to refer to log P(B1|H), and call it the amount of evidence 1 P(B1|H¯) provided by the proposition B in favour of the proposition H. 1 No finite number of coin tosses can ever provide enough evidence to prove that the bias is in favour of heads or of tails, because the logarithm of the odds of a proposition must reach infinity in order for the probability of that proposition to reach one. Instead one can introduce a threshold for evidence, and if the amount of accumulated evidence in favour of a proposition exceeds that threshold, one can pass the judgment that the proposition is true, having been persuaded by the evidence. The logarithm of the odds of H, log P(H), could be called the amount of P(H¯) evidence in favour of H, and denoted by e(H). In cases where P(H) = 0, or P(H) = 1, however, this quantity is infinite and does not change when new 7 evidence in favour of H or against H is given. Keeping track of the amount of evidence whichhasaccumulatedis thereforenotaccomplishedby keepingtrack of P(H). If we want, for example, to be able to initially believe that the bias of the coin is in favour of tails, P(H)= 0, but change and believe that it is in favour of heads when the accumulated evidence has reached some threshold4, then it wouldbenecessarytokeeptrackofthequantityofaccumulatedevidence,ea(H), instead of e(H). ea(H) would start at zero and receive additive contributions from each observation of a coin toss. Until the threshold for ea(H) is reached, P(H) would remain at zero and e(H) would remain at −∞. Evidence is related to information as follows: P(B|A) P(B|A) P(B) e(B →A)=log =log +log =i(A;B)−i(A¯;B) P B|A¯ P(B) P B|A¯ (cid:0) (cid:1) (cid:0) (cid:1) 4.2 When a Proposition with Probability Zero is Given The quantity P(B|A) P(B) e(B →A)=log +log =i B|A¯ −i(B|A) P(B) P B|A¯ (cid:0) (cid:1) (cid:0) (cid:1) has another significance with respect to judgment in circumstances in which P(A)=0. In those circumstances, P(B)=P B|A¯ so i(B)=i B|A¯ . In order to pass the judgment that A is tr(cid:0)ue, it(cid:1)is necessary(cid:0)to kn(cid:1)ow what changes to make to the probabilities of other propositions such as B. This is equivalent to specifying the changes that should be made to quantities of information such as i(B). If i(B) = i B|A¯ initially, then the quantity which must be subtracted from it when A is(cid:0)given(cid:1)is i B|A¯ −i(B|A)=e(B →A). The amount of evidence provided by B in fa(cid:0)vour(cid:1)of A is therefore equal to theamountbywhichi(B)shouldchangeifAisgiveninacircumstanceinwhich P(A)=0. In the example where the results of coin tosses are observed, it might be initially believed that the bias is in favourof tails, P(H)=0, in which case the probabilitythatthe nexttosswilllandonheads,P(Bn),wouldbeP Bn|H¯ = 0.1. (cid:0) (cid:1) If H is given, i(Bn) will change to: 0.9 i(Bn|H)=−log0.1−e(Bn →H)=−log0.1−log =−log0.9 0.1 so P(Bn) would change to 0.9, which is P(Bn|H). It is therefore sufficient to know the values of quantities of evidence such as e(Bn → H) in order to know what changes to make to the probabilities of propositions when a proposition of probability zero, such as H, is given. 4Sinceajudgmentwhichismadeonthebasisofafiniteamountofevidencealwayscarries withittheriskoferror,itiswisetoretainthepossibilityofmakingtheoppositejudgmentif enoughevidencesubsequentlyaccumulates favouringtheoppositeconclusion. 8 4.3 Evidence and Independence If P(A) = 0, then i(B|A) = i(B)−e(B → A) so if A is judged to be true, e(B →A) will be subtracted from i(B). ToundothejudgmentthroughwhichAwasgiven,andreturntotheoriginal circumstance,the same quantity which was subtractedfrom i(B) can be added to the new value of i(B) to obtain the original value of i(B). The quantity which is to be added is then equal to the old value of e(B → A), that is, the value which e(B →A) had before A was given. Performing this addition must be equivalent to subtracting the new value of e B →A¯ since this is what must be subtracted from i(B) when P A¯ =0 and(cid:0)A¯ is give(cid:1)n. Since e(B →A) is equal to −e B →A¯ in every circum(cid:0)st(cid:1)ance, this shows that e(B → A) does not change w(cid:0)hen eith(cid:1)er A or A¯ is given in a circumstance where its initial probability is zero, unlike, for example, i(A;B). Whenever i(A;B) > 0, i(A¯;B) ≤ 0, and, correspondingly, i(A;B) < 0 implies thati(A¯;B)≥0,soifthe amountofevidence thatB providesinfavour of A is zero, then the amount of information common to A and B is zero. The converse is not true, however. That is, it is possible for i(A;B) to be zerowhilee(B →A)isnon-zero,namelyifAhasprobabilityone. Thecondition that P(A)P(B) =P(AB) is therefore a weaker type of independence than the condition that e(B →A)=0. Even if e(B →A)=0, it is still possible for e(A→B) to be different from zero, namely if P(B)=1. The quantity: em(A;B)≡i(A;B)−i(A¯;B)−i(A;B¯)+i(A¯;B¯)=e(B →A)−e(B¯ →A) is what must equal zero in order to ensure that A and B are fully independent, that is, that each of the four quantities i(A;B), i(A¯;B), i(A;B¯) and i(A¯;B¯) vanishes. em(A;B) is the amount by which the log of the odds of A changes if B is given in a circumstance where P(B) = 0. Since it is symmetric, it is also the amount by which the log of the odds of B changes if A changes from being believed to be false to being believed to be true. em(A;B) can be called the amount of evidence which A and B mutually provide in favour of one another, or the mutual evidence, since it is a quantity of evidence which is symmetric under interchange of the propositions A and B, and it pertains to each proposition in respect of the other. i(A;B) is called commoninsteadofmutual because the informationreferredto pertains to each propositionaswellastheother,ratherthaninrespectoftheother. Forreasons analogous to the case of e(B → A), em(A;B) does not change when any of A, A¯, B or B¯ is believed to be false but then given. 5 Implication InpropositionallogicitiscustomarytousethepropositionBorA¯asthelogical ormathematicalrepresentationofthe implicationwhichisexpressedinEnglish as “If A then B”. 9 We can consider the information common to A¯ and B or A¯: i A¯;B or A¯ =logP(A¯ and (B or A¯)) =log P(A¯) P(A¯)P(B or A¯) P(A¯)P(B or A¯) (cid:0) (cid:1) =log 1 =i B or A¯ P(B or A¯) (cid:0) (cid:1) Unless it is already believed that B is true or A is false, this quantity is positive. This implies that: i A¯|B or A¯ =i(A¯)−i B or A¯ <i(A¯) (cid:0) (cid:1) (cid:0) (cid:1) whichinturnimpliesthatP A¯|B or A¯ >P A¯ ,orequivalentlyP A|B or A¯ < P(A). (cid:0) (cid:1) (cid:0) (cid:1) (cid:0) (cid:1) This result can be stated in words by saying that if it is judged that B is true or A is false then the probability of A must decrease unless it was already believed that B is true or A is false. Similarly, the probability of B must increase. If we examine the senses in which the English expression “If A then B” can be used, however, we find that it is not always the case that incorporating the information provided leads us to regard A as less probable and B as more probable. Four cases can be distinguished: • Both P(A) and P(B) change. • P(A) remains unchanged; P(B) changes. • P(A) changes; P(B) remains unchanged. • Both P(A) and P(B) remain unchanged. We can examine each of the four cases in turn, using the letter T to denote the proposition which is given by the judgment establishing that A implies B. 5.1 The Judgment that B is True or A is False P(A¯|T)=P(A¯)/P(A¯ or B) and P(B|T)=P(B)/P(A¯ or B) This case is the familiar identification of T with A¯ or B, the so-called ma- terial implication. The minimum amount of information associated with the judgment is clearly i(A¯ or B). Unlike the other cases, the new probabilities of the propositions A and B, thatis,the probabilitiesofthosepropositionsafterthe judgment, arenotequal to old probabilities of logical expressions such as AB or B or A. In this case, if T¯ is given, AB¯ is given, and so the negation of the material implication, A¯ or B, does notyield another relationofimplication between the relevant propositions. The assignmentsof probabilities accomplishedby this judgment are left un- changed by the substitution of B¯ for A and A¯ for B, because the expression A¯ or B is left unchanged by this substitution. 10

See more

The list of books you might like