Logout succeed
Logout succeed. See you again!

Molecular Constants Mostly from Microwave, Molecular Beam, and Sub-Doppler Laser Spectroscopy: Paramagnetic Diatomic Molecules (Radicals), Part 1 PDF
Preview Molecular Constants Mostly from Microwave, Molecular Beam, and Sub-Doppler Laser Spectroscopy: Paramagnetic Diatomic Molecules (Radicals), Part 1
New Series Numerical Data and Functional Relationships in Science and Technology GROUP II VOLUME 29 Molecules Molecular and Radicals Constants Mostly from Microwave, Molecular Beam, and Sub-Doppler Laser Spectroscopy SUBVOLUME E Paramagnetic Diatomic Molecules (Radicals) Part 1 123 MATERIALS.SPRINGER.COM € Landolt-Bornstein: Numerical Data and Functional Relationships in Science and Technology – New Series Group II: Molecules and Radicals Volume 29 € Landolt-Bornstein Numerical Data and Functional Relationships in Science and Technology New Series Units and Fundamental Constants in Physics and Chemistry Elementary Particles, Nuclei and Atoms (Group I) (Formerly:NuclearandParticlePhysics) Molecules and Radicals (Group II) (Formerly:AtomicandMolecularPhysics) Condensed Matter (Group III) (Formerly:SolidStatePhysics) Physical Chemistry (Group IV) (Formerly:MacroscopicPropertiesofMatter) Geophysics (Group V) Astronomy and Astrophysics (Group VI) Biophysics (Group VII) Advanced Materials and Technologies (Group VIII) Someofthegroupnameshavebeenchangedtoprovideabetterdescriptionoftheircontents. € Landolt-Bornstein Numerical Data and Functional Relationships in Science and Technology New Series Group II: Molecules and Radicals Volume 29 Supplement to Volumes II/4, II/6, II/14, II/19, and II/24 Molecular Constants Mostly from Microwave, Molecular Beam, and Sub-Doppler Laser Spectroscopy Subvolume E Paramagnetic Diatomic Molecules (Radicals) Part 1 Editor W. Hu¨ttner Author D. Christen Editor WolfgangHu¨ttner Universita¨tUlm Institutfu¨rQuanteninformationsverarbeitung Ulm,Germany Author DinesChristen Universita¨tTu¨bingen Institutfu¨rPhysikalischeundTheoretischeChemie Tu¨bingen,Germany ISSN1615-1852 ISSN1616-9530(electronic) ISBN978-3-662-49197-3 ISBN978-3-662-49199-7(eBook) https://doi.org/10.1007/978-3-662-49199-7 LibraryofCongressControlNumber:2016962055 ©Springer-VerlagBerlinHeidelberg2017 Thisworkissubjecttocopyright.AllrightsarereservedbythePublisher,whetherthewholeorpartofthematerialisconcerned, specificallytherightsoftranslation,reprinting,reuseofillustrations,recitation,broadcasting,reproductiononmicrofilmsorinany otherphysicalway,andtransmissionorinformationstorageandretrieval,electronicadaptation,computersoftware,orbysimilaror dissimilarmethodologynowknownorhereafterdeveloped. Theuseofgeneraldescriptivenames,registerednames,trademarks,servicemarks,etc.inthispublicationdoesnotimply,eveninthe absenceofaspecificstatement,thatsuchnamesareexemptfromtherelevantprotectivelawsandregulationsandthereforefreefor generaluse. Thepublisher,theauthorsandtheeditorsaresafetoassumethattheadviceandinformationinthisbookarebelievedtobetrueand accurateatthedateofpublication.Neitherthepublishernortheauthorsortheeditorsgiveawarranty,expressorimplied,withrespect tothematerialcontainedhereinorforanyerrorsoromissionsthatmayhavebeenmade.Thepublisherremainsneutralwithregardto jurisdictionalclaimsinpublishedmapsandinstitutionalaffiliations. Printedonacid-freepaper ThisSpringerimprintispublishedbySpringerNature TheregisteredcompanyisSpringer-VerlagGmbH,DE Theregisteredcompanyaddressis:HeidelbergerPlatz3,14197Berlin,Germany Preface ThepresentsubvolumeII/29E1 oftheLandolt-B€ornsteinvolumeII/29MolecularConstantsMostlyfrom Microwave,MolecularBeam,andSub-DopplerLaserSpectroscopycontainsthespectroscopicparameters ofsome145diatomicfreeradicals.TheremainingoneswillappearinsubvolumeII/29E2.Theliteratureup toandincludingtheyear2010istakenintoaccount,startingfrom1997orsometimesearlier.Previousdata onparamagneticspeciescanbefoundinvolumesII/4,II/6,II/14,II/19,andII/24. Theparamagneticdiatomicmoleculesinthissubvolumeareorderedquasi-alphabeticallyfollowingthe rules of Hill’s system (E.A. Hill: J. Am. Chem. Soc. 22 (1900) 478). The numerous intramolecular interactions and their Hamiltonians are presented in the introduction where also the coupling parameters aredefined.Thebasicpublicationsinthefieldarecited. LikeinsubvolumeII/24D2,thespinandorbitalelectronicg-factorsarechosentobenegative,following thesuggestionofJ.M.Brownetal.:Mol.Phys.98(2000)1597.Inthisway,theelectronisincludedinthe generalrulethatthesignofag-value determineswhetherthemagnetic-momentvector pointsparallelor antiparallel to the corresponding angular momentum. The electron has thus lost its exceptional status compared to nuclear or molecular rotational magnetism. Similarly, the sign of the nuclear spin-rotation constantischosensuchthatitreflectstheoriginoftherotationallyinducedmagneticfield:itisnegativeif the field of the electronic cloud overcomes that of the nuclear frame, and positive otherwise (when the nuclearg-value ispositivelikeinmostcases; details can befound insubvolumeII/24C).Theauthorhas indicatedinthetableswhenaparametersignwaschangedfromthatoftheoriginalliterature. Thanks are due to the author for his competent work in a demanding, diverse field, and also to the editorialstaffofLandolt-B€ornstein,especiallyDipl.-Phys.AntjeEndemann,forcompletingthishandsome issue. Ulm,June2016 TheEditor v Contents IntroductiontoHigh-ResolutionSpectroscopy. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1 IntroductiontotheParametersofParamagneticDiatomicMolecules. . . . . . . . . . . . . . . . . . . 6 MolecularConstantsofAgOX2Π SilverOxide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 16 i DissociationEnergyofAlArX2Π Aluminum-ArgonDimer. . . . . . . . . . . . . . . . . . . . . . . . . . 20 i MolecularConstantsofAlKrX2Π Aluminum-KryptonDimer. . . . . . . . . . . . . . . . . . . . . . . 21 1/2 DissociationEnergyofAlNeX2Π Aluminum-NeonDimer. . . . . . . . . . . . . . . . . . . . . . . . . . . 24 i MolecularConstantsofAlOX2Σ+AluminumOxide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 26 MolecularConstantsofAl X3Π Dialuminum. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 29 2 u SpectroscopicConstantsofArAuX2ΣArgon-GoldDimer. . . . . . . . . . . . . . . . . . . . . . . . . . . 31 MolecularConstantsofArBX2Π Argon-BoronDimer. . .. . . .. . . . .. . . . .. . . .. . . . .. . . . 33 i DissociationEnergyofArCa+X2Σ+Argon-CalciumDimer(1+)Ion. . . . . . . . . . . . . . . . . . . . 36 SpectroscopicConstantsofArClX1/2ArgonChloride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 37 SpectroscopicConstantsofArGaX2Π Gallium-ArgonDimer. . . . . . . . . . . . . . . . . . . . . . . 39 1/2 MolecularConstantsofArGeX3Σ(cid:1)Argon-GermaniumDimer. . . . . . . . . . . . . . . . . . . . . . . 41 MolecularConstantsofArHX2Σ+ArgonHydride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 43 MolecularConstantsofAlHe+X2Σ+ HeliumArgon(1+)Ion. . . . . . . . . . . . . . . . . . . . . . . . 51 1/2 MolecularConstantsofArInX2Π Indium-ArgonDimer. . . . . . . . . . . . . . . . . . . . . . . . . . . 55 1/2 MolecularConstantsofArKX2Σ+Argon-Potassium(1/1)Dimer. . . . . . . . . . . . . . . . . . . . . . 56 SpectroscopicConstantsofArKr+X 2Σ+Argon-Krypton(1/1)(1+)Ion. . . . . . . . . . . . . . . . 60 1/2 MolecularConstantsofArLiX2Σ+Argon-Lithium(1/1)Dimer. . . . . . . . . . . . . . . . . . . . . . . 63 MolecularConstantsofArNaX2Σ+Argon-Sodium(1/1)Dimer. . . . . . . . . . . . . . . . . . . . . . . 70 MolecularConstantsofArNe+X2Σ +NeonArgon(1+)Ion. . . . . . . . . . . . . . . . . . . . . . . . . 74 1/2 MolecularConstantsofArNi(Ground-StateUnassigned)Argon-Nickel(1/1)Dimer. . . . . . . . 75 MolecularConstantsofArSiX3Σ(cid:1)Silicon-Argon(1/1)Dimer. . . . . . . . . . . . . . . . . . . . . . . . 77 DissociationEnergiesofArSnX3Σ(cid:1)Tin-Argon(1/1)Dimer. . . . . . . . . . . . . . . . . . . . . . . . . . 79 MolecularConstantsofArXe+X 2Σ+Argon-Xenon(1/1)(1+)Ion. . . . . . . . . . . . . . . . . . . . 80 1/2 MolecularConstantsofAr +X2Σ +Diargon(1+)Ion. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 84 2 1/2 MolecularConstantsofAsBrX3Σ(cid:1)(X 0+,X 1)Bromoarsinidene. . . . . . . . . . . . . . . . . . . . . . 88 1 2 MolecularConstantsofAsHX3Σ(cid:1)Arsinidene. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 92 SpectroscopicConstantsofAsIX3Σ(cid:1)(X 0+,X 1)Iodoarsinidene. . . . . . . . . . . . . . . . . . . . . . 98 1 2 SpectroscopicConstantsofAuKrX2Σ+ GoldKrypton(1/1). . . . . . . . . . . . . . . . . . . . . . . . 100 1/2 vii viii Contents MolecularConstantsofAuNa(cid:1)X2ΣGoldSodium(1/1)(1–)Ion. . . . . . . . . . . . . . . . . . . . . . . 102 MolecularConstantsofAuOX2Π ,X2Π GoldOxide. . . . . . . . . . . . . . . . . . . . . . . . . . . . 103 1/2 3/2 MolecularConstantsofAuSX2Π ,X2Π GoldSulfide. . . . . . . . . . . . . . . . . . . . . . . . . . . . 107 1/2 3/2 SpectroscopicParametersofAuSiX2ΣGoldSilicide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 108 MolecularconstantsofBH+X2Σ+Hydroboron(1+)ion. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 110 MolecularConstantsofBIrX3Δ IridiumBoride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 112 3 MolecularConstantsofBKrX2Π BoronKryptonDimer. . . . . . . . . . . . . . . . . . . . . . . . . . 116 1/2 MolecularConstantsofBNeX2ΠBoron-NeonDimer. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 118 MolecularConstantsofBOX2Σ+BoronMonoxide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 120 MolecularConstantsofBSiX4Σ(cid:1)BoronSilicide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 125 RovibronicTermEnergyValuesofB X3Σ (cid:1)Diboron. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 127 2 g MolecularConstantsofBaFX2Σ+BariumFluoride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 128 MolecularConstantsofBaHX2Σ+BariumHydride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 141 MolecularConstantsofBaIX2Σ+BariumIodide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 145 MolecularConstantsofBeHX2Σ+BerylliumHydride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 150 PotentialEnergyCurveofBeO+X2ΠOxoberyllium(1+)Ion. . . . . . . . . . . . . . . . . . . . . . . . . 166 MolecularConstantsofBiNaX3Σ(cid:1)BismuthSodiumDimer. . . . . . . . . . . . . . . . . . . . . . . . . . 167 MolecularConstantsofBiOX2Π BismuthOxide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 170 i MolecularConstantsofBiSX2Π BismuthSulfide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 176 1/2 MolecularConstantsofBiSeX2Π BismuthSelenide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 180 1/2 MolecularConstantsofBiTeX2Π BismuthTelluride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 182 1/2 MolecularConstantsofBrCl+X2Π BromineChloride(1+)Ion. . . . . . . . . . . . . . . . . . . . . . 184 3/2 MolecularConstantsofBrH+X2Π Bromoniumyl. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 186 3/2 MolecularConstantsofBrH2+X3Σ(cid:1)Bromohydrogen(2+)Ion. . . . . . . . . . . . . . . . . . . . . . . . 188 MolecularConstantsofBrHfX2Δ HafniumBromide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 190 3/2 MolecularConstantsofBrI+X2Π Bromoiodine(1+)Ion. . . . . . . . . . . . . . . . . . . . . . . . . . . 192 3/2 MolecularConstantsofBrI(cid:1)X2Σ +Bromoiodate(1(cid:1)). . . . . . . . . . . . . . . . . . . . . . . . . . . . . 194 1/2 PotentialParametersofBrKrX1/2KryptonBromide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 196 MolecularConstantsofBrMgX2Σ+MagnesiumBromide. . . . . . . . . . . . . . . . . . . . . . . . . . . 198 SpectroscopicConstantsofBrNX3Σ(cid:1)NitrogenBromide. . . . . . . . . . . . . . . . . . . . . . . . . . . . 202 MolecularConstantsofBrNiX2Π NickelBromide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 204 3/2 MolecularConstantsofBrOX2Π BromineOxide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 218 3/2 MolecularConstantsofBrO+X3Σ(cid:1)BromineOxide(1+)Ion. . . . . . . . . . . . . . . . . . . . . . . . . 224 MolecularConstantsofBrPX3Σ(cid:1)Bromophosphinidene. . . . . . . . . . . . . . . . . . . . . . . . . . . . 226 SpectroscopicConstantsofBrSbX3Σ(cid:1)Bromostibylene. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 230 Contents ix MolecularConstantsofBrSrX2Σ+StrontiumBromide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 232 MolecularConstantsofBrTiX4Φ TitaniumBromide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 236 i Morse-MorseSwitching-VanDerWaalsPotentialParametersof BrXeX1/2XenonBromide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 241 MolecularConstantsofBrYbX2Σ+YtterbiumBromide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 243 MolecularConstantsofBr +X2Π BromineMolecular(1+)Ion. . . . . . . . . . . . . . . . . . . . . . . 248 2 g MolecularConstantsofCArX3Σ(cid:1)Carbon-ArgonDimer. . . . . . . . . . . . . . . . . . . . . . . . . . . . 251 MolecularConstantsofCBX4Σ(cid:1)BoronCarbide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 253 MolecularConstantsofCBrX2Π Bromomethylidyne. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 255 1/2 SpectroscopicConstantsofCCaX3Σ(cid:1)CalciumCarbide. . . . . . . . . . . . .. . . . . . . . . . . . . . . . 258 EquilibriumMolecularParametersofCClX2ΠChloromethylidyne. . . . .. . . . . . . .. . . . . . . 260 MolecularConstantsofCCoX2Σ+CobaltCarbide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 262 RotationalParametersofCCrX3Σ(cid:1)ChromiumCarbide. . . . . . . . . . . . . . . . . . . . . . . . . . . . 265 SpectroscopicConstantsofCFX2ΠFluoromethylidyne. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 267 MolecularConstantsofCFeX3Δ IronCarbide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 271 i MolecularConstantsofCFe+X2Δ IronCarbideCation. . . . . . . . . . . . . . . . . . . . . . . . . . . 282 5/2 MolecularConstantsofCHX2ΠMethylidyne. .. . . . . . . . . . . .. . . . . . . . . . . . .. . . . . . . . . . 284 EquilibriumMolecularConstantsofCIrX2Σ+IridiumCarbide. . . . . . . . . . . . . . . . . . . . . . . 296 MolecularConstantsofCKX4Σ(cid:1)PotassiumCarbide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 299 SpectroscopicConstantsofCMoX3Σ(cid:1)MolybdenumCarbide. . . . . . . . . . . . . . . . . . . . . . . . 301 MolecularConstantsofCNX2Σ+Cyanogen. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 305 RotationalandFine-StructureParametersofCNaX4Σ(cid:1)SodiumCarbide. . . . . . . . . . . . . . . 312 MolecularConstantsofCNbX2Δ NiobiumCarbide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 314 3/2 MolecularConstantsofCO+X2Σ+CarbonMonoxide(1+)Ion. . . . . . . . . . . . . . . . . . . . . . . . 316 MolecularConstantsofCO2+X3ΠCarbonMonoxideDication. . . . . . . . . . . . . . . . . . . . . . . . 326 MolecularConstantsofCOsX3ΔOsmiumCarbide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 328 StructuralandThermodynamicInformationofCOs+X2ΔMethanetetraylosmium(1+). . . . 337 StructuralandThermodynamicInformationofCOs(cid:1)X2ΔMethanetetraylosmate(1(cid:1)). . . . 338 MolecularConstantsofCPX2Σ+Phosphinidynemethyl. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 339 MolecularConstantsofCRhX2Σ+RhodiumCarbide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 340 MolecularConstantsofCRh(cid:1)X3ΠRhodiumCarbideAnion(1(cid:1)). . . . . . . . . . . . . . . . . . . . . 344 MolecularConstantsofCS+X2Σ+CarbonSulfide(1+)Ion. . . . . . . . . . . . . . . . . . . . . . . . . . . 346 MolecularConstantsofCScX2ΠScandiumCarbide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 349 RotationalConstantsofCSiX3ΠSiliconCarbide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 350 SpectroscopicConstantsofCTaX2Σ+TantalumCarbide. . . . . . . . . . . . . . . . . . . . . . . . . . . . 352 x Contents PotentialEnergyCurvesofCTa+X3Σ+Methanetetrayltantalum(1+)Ion. . . . . . . . . . . . . . . 355 BondEnergyofCTcX4Σ+TechnetiumCarbide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 356 MolecularConstantsofCTiX3Σ+TitaniumCarbide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 357 ZeemanConstantsofCVX2ΔVanadiumCarbide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 358 MolecularConstantsofCWX3Δ TungstenCarbide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 359 1 SpectralPeakPositionsofCW(cid:1)X2Δ MethanetetrayltungstateTungsten 3/2 Carbide(1–)Ion. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 361 RotationalConstantsofCZrX3Σ+ZirconiumCarbide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 363 MolecularConstantsofC +X4Σ (cid:1)Ethynylium–1–yl. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 365 2 g MolecularConstantsofC (cid:1)X2Σ +Ethynyl(1–)Ion. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 367 2 g MolecularConstantsofCaClX2Σ+CalciumChloride. . . . .. . . . .. . . . .. . . . .. . . . .. . . . .. 368 MolecularConstantsofCaFX2Σ+CalciumFluoride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 369 MolecularConstantsofCaHX2Σ+CalciumHydride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 373 BondEnergyofCaKr+X2Σ+Krypton-CalciumDimer(1+)Ion. . . . . . . . . . . . . . . . . . . . . . . 380 BondEnergyofCaXe+X2Σ+Xenon-CalciumDimer(1+)Ion. . . . . . . . . . . . . . . . . . . . . . . . . 381 MolecularConstantsofCdHX2Σ+CadmiumHydride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 382 MolecularConstantsofClCoX3Φ CobaltChloride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 386 4 MolecularConstantsofClCrX6Σ+ChromiumChloride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 395 SpectroscopicConstantsofClDyX7.5DysprosiumChloride. . . . . . . . . . . . . . . . . . . . . . . . . 398 MolecularConstantsofClFeX6Δ IronChloride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 402 3/2 MolecularConstantsofClGeX2ΠGermaniumChloride. . . . . . . . . . . . . . . . . . . . . . . . . . . . 407 SpectroscopicConstantsofClH+X2Π Chloroniumyl. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 411 3/2 MolecularConstantsofClH++X3Σ(cid:1)Chlorohydrogen(2+)Ion. . . . . . . . . . . . . . . . . . . . . . . . 415 SpectroscopicPropertiesofClHeX1/2HeliumChlorine(1/1)Dimer. . . . . . . . . . . . . . . . . . . 418 MolecularConstantsofClHfX2Δ HafniumChloride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 419 3/2 MolecularConstantsofClHoX8(Ω=8)HolmiumChloride. . . . . . . . . . . . . . . . . . . . . . . . . 422 PotentialParametersofClKrX1/2KryptonChloride. .. . . .. . . .. . . .. . . .. . . .. . . .. . . .. 425 MolecularConstantsofClMgX2Σ+MagnesiumChloride. . . . . . . . . . . . . . . . . . . . . . . . . . . . 427 MolecularConstantsofClMnX7Σ+ManganeseChloride. . . . . . . . . . . . . . . . . . . . . . . . . . . . 430 MolecularConstantsofClNX3Σ(cid:1)NitrogenChloride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 433 SpectroscopicConstantsofClNbX5ΠNiobiumChloride. . . . . . . . . . . . . . . . . . . . . . . . . . . . 436 SpectroscopicPropertiesofClNeX1/2NeonChlorine(1/1)Dimer. . . . . . . . . . . . . . . . . . . . . 438 MolecularConstantsofClNiX2Π NickelChloride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 439 3/2 MolecularConstantsofClOX2ΠChlorineOxide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 450 MolecularConstantsofClPbX2Π LeadChloride. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 456 i