loading

Logout succeed

Logout succeed. See you again!

ebook img

Molecular Magnets: Physics and Applications PDF

pages401 Pages
release year2014
file size14.001 MB
languageEnglish

Preview Molecular Magnets: Physics and Applications

NanoScience and Technology Juan Bartolomé Fernando Luis Editors Julio F. Fernández Molecular Magnets Physics and Applications NanoScience and Technology SeriesEditors PhaedonAvouris,YorktownHeights,NewYork,USA BharatBhushan,Columbus,Ohio,USA DieterBimberg,Berlin,Germany KlausvonKlitzing,Stuttgart,Germany HiroyukiSakaki,Tokyo,Japan RolandWiesendanger,Hamburg,Germany Forfurthervolumes: www.springer.com/series/3705 TheseriesNanoScienceandTechnologyisfocusedonthefascinatingnano-world, mesoscopic physics, analysis with atomic resolution, nano and quantum-effect devices, nanomechanics and atomic-scale processes. All the basic aspects and technology-orienteddevelopmentsinthisemergingdisciplinearecoveredbycom- prehensiveandtimelybooks.Theseriesconstitutesasurveyoftherelevantspecial topics,whicharepresentedbyleadingexpertsinthefield.Thesebookswillappeal toresearchers,engineers,andadvancedstudents. Juan Bartolomé (cid:2) Fernando Luis (cid:2) Julio F. Fernández Editors Molecular Magnets Physics and Applications Editors JuanBartolomé JulioF.Fernández InstituteofMaterialScienceofAragónand InstituteofMaterialScienceofAragónand DepartmentofCondensedMatterPhysics DepartmentofCondensedMatterPhysics CSIC–UniversityofZaragoza CSIC–UniversityofZaragoza Zaragoza,Spain Zaragoza,Spain FernandoLuis InstituteofMaterialScienceofAragónand DepartmentofCondensedMatterPhysics CSIC–UniversityofZaragoza Zaragoza,Spain ISSN1434-4904 ISSN2197-7127(electronic) NanoScienceandTechnology ISBN978-3-642-40608-9 ISBN978-3-642-40609-6(eBook) DOI10.1007/978-3-642-40609-6 SpringerHeidelbergNewYorkDordrechtLondon ©Springer-VerlagBerlinHeidelberg2014 Thisworkissubjecttocopyright.AllrightsarereservedbythePublisher,whetherthewholeorpartof thematerialisconcerned,specificallytherightsoftranslation,reprinting,reuseofillustrations,recitation, broadcasting,reproductiononmicrofilmsorinanyotherphysicalway,andtransmissionorinformation storageandretrieval,electronicadaptation,computersoftware,orbysimilarordissimilarmethodology nowknownorhereafterdeveloped.Exemptedfromthislegalreservationarebriefexcerptsinconnection with reviews or scholarly analysis or material supplied specifically for the purpose of being entered and executed on a computer system, for exclusive use by the purchaser of the work. Duplication of this publication or parts thereof is permitted only under the provisions of the Copyright Law of the Publisher’slocation,initscurrentversion,andpermissionforusemustalwaysbeobtainedfromSpringer. PermissionsforusemaybeobtainedthroughRightsLinkattheCopyrightClearanceCenter.Violations areliabletoprosecutionundertherespectiveCopyrightLaw. Theuseofgeneraldescriptivenames,registerednames,trademarks,servicemarks,etc.inthispublication doesnotimply,evenintheabsenceofaspecificstatement,thatsuchnamesareexemptfromtherelevant protectivelawsandregulationsandthereforefreeforgeneraluse. Whiletheadviceandinformationinthisbookarebelievedtobetrueandaccurateatthedateofpub- lication,neithertheauthorsnortheeditorsnorthepublishercanacceptanylegalresponsibilityforany errorsoromissionsthatmaybemade.Thepublishermakesnowarranty,expressorimplied,withrespect tothematerialcontainedherein. Printedonacid-freepaper SpringerispartofSpringerScience+BusinessMedia(www.springer.com) Preface Thisbookaimstoprovideacoherentandpedagogicalcollectionofarticlesonthe physicsandapplicationsofmolecularmagnets.Allcontributorshaveplayedama- jor role in either (1) discovering or elucidating the physics that underlies molecu- larmagnets,orin(2)thepresentexplorationofavenuestowardtheirapplications. Issues that are by now well understood as well as open questions are covered. In- evitably, overlaps among some chapters do occur, but we are sure that the reader willfindthemcomplementaryratherthanrepetitious. Molecular magnets are made up of chemically identical molecules with high– spin cores. The cornerstone for the rise of present day interest in molecular magnetism was the discovery of magnetic quantum tunneling in Mn -acetate 12 molecules. There was before 1996 some indirect evidence for quantum tunneling of large spins. In 1993, magnetic hysteresis (and thus magnetic memory) at liq- uid Helium temperatures was shown to come from single molecular clusters of Mn -acetate.However,aclearimprintofmagneticquantumtunnelingwasonlyob- 12 servedin1996.Then,experimentsrevealedthatmagnetichysteresisinMn -acetate 12 is rather unconventional, in that the magnetization jumps at equally spaced values oftheappliedmagneticfield.Thegistofthiseffectisthatspinscantunnelbetween different magnetic states as they are brought on and off resonance by an external magneticfield.Mn -acetatemoleculesthusbehaveas“singlemoleculemagnets” 12 (SMMs). “Resonant spin tunneling” in molecular magnets illustrates beautifully quantumphysicsatthemesoscopicscale,thatis,inthecrossoverregionbetweenthe macroscopic and microscopic worlds, where quantum and classical physics meet. Finally, SMMs are a variant of magnetic nanoparticles, which are at the basis of magneticrecording.MuchinterestinSMMsarisesfromthisfact. Thefieldhasexpandedconsiderablyinthelasttwodecades,owingtothecreativ- ity of molecular chemists (who have crafted high and low spin clusters and single chainmagnets),totheobservationandelucidationofinterestingphenomena(e.g., hole burning, spin avalanches and deflagration, as well as dipolar long-range or- dering), and to the development of experimental techniques (e.g., single molecule manipulationonsubstrates).Finally,thereisthevibrantongoingworkonapplica- tions.Mostofithastodowiththefactthatsinglemoleculemagnetsarepotential v vi Preface 2-level qubits for quantum computation. There are other applications for molecu- larmagnets,suchastomagneticrefrigeration(makinguseofthemagneto–caloric effect)ofelectronicdevicesatcryogenictemperatures. A brief historical account of the discovery of stepwise hysteresis loops, which are the hallmark of molecular magnets, as well as the physics of the underlying magnetic-quantum-tunnelingphenomena,canbereadinthefirstsection,Tunneling of Single Molecule Magnets. How stepwise hysteresis loops were discovered, and firstreportedearlyin1996,isthesubjectofChap.1.Howtheexistenceofstepwise hysteresisloopswassubsequentlycorroboratedinMn -acetatesinglecrystals,and 12 more,canbereadinChap.2.Thetheoryofmagneticquantumtunnelingthattakes orbitalangularmomentumintoaccountisgiveninChap.3.Thereishowevermore in the first section. Interesting effects that cannot be accounted for assuming each SMMactsasasinglespinSarereportedandexplainedinChap.4. Thesecondsection,BeyondSingleMolecules,coversvariouscollectivephenom- ena.Deflagrationisoneofthem.Ithasbeenfoundtoproceedinmolecularmagnets byrapidlymovingmagnetic-quantum-tunnelingfronts,muchasordinarydeflagra- tion takes place by chemical combustion processes. Experimental and theoretical accounts are given in Chaps. 5 and 6, respectively. A rather different sort of col- lective phenomenon, equilibrium magnetic phase transitions, have been observed insomeofthebestknownmolecularmagnets.Magneticorderingisbroughtabout by magnetic-dipolar interactions. Because system-wide ordering processes cannot bypassslowquantumtunnelingprocesses,therealizationofmagneticorderingwas notaforegoneconclusion.Ordercaneitherbedestroyedbyheating,throughaclas- sicalphasetransition,orbyapplyingatransversemagneticfield,throughaquantum phasetransition.ThisisthesubjectofChap.7.SingleChainMagnets,thesubject of Chap. 8, resemble SMMs in that they can relax extremely slowly. Their under- lying physics is however rather different. In single chain magnets relaxation pro- ceedsthroughthermalexcitationofdomainwalls.Modelsarealsodiscussedinthis chapter.Metal-phthalocyanine(MPc)areuniquelysuitedfortheexplorationofthe intrinsic mechanisms which give rise to molecular magnetism. The structural and magneticpropertiesofbulkcrystals,thinfilmsandsingleMPcsmoleculesadsorbed ondifferentsubstratesarecoveredinChap.9.TheKondointeraction,tunnelingpro- cesses,switchabilityandspincontrolarereviewed. MostofthesectiononApplicationsisdevotedtoissuesthatarisefromtherole molecular magnets can play in information technology. How to control and ex- ploitthequantumpropertiesofSMMs,achievementsofrecentyearsandforesight for their near future are all weaved into Molecular Nanomagnets for Information Technologies, which is Chap. 10. In Chap. 11, Molecular Magnets for Quantum InformationProcessing,abriefintroductionintoquantumcomputingisgiven.Di- Vincenzo’s criteria for its successful physical implementation are introduced and used as a guideline throughout. Utilization and control (mainly, through the spin- electric effect) of the spin degrees of freedom in SMMs as qubit states is consid- ered. The various decoherence mechanisms which affect SMMs and their advan- tagesonthispointovermoretraditionalqubitsareexamined.Finally,aproposalto implementGrover’salgorithmusingmolecularmagnetsisdiscussed.InChap.12, Preface vii Single Molecule Spintronics, recently developed techniques that can be applied to measurementsofelectronictransportthroughaSMMarediscussed.Spectroscopic information,obtainedfrommeasurementsonspin-transistor-likethree-terminalset ups,confirmsthehigh-spinstateandmagneticanisotropyoftherobustFe SMM. 4 The experimental observation that electric gate fields drastically modify the mag- neticpropertiesofanoxidizedorreducedmoleculeisdiscussed.Themainaimof molecularquantumspintronics,thatis,tobringtogetherconceptsfromspintronics, molecularelectronicsandquantumcomputingforthepurposeoffabrication,char- acterization, and study of molecular devices—such as, molecular spin-transistors and molecular spin-valves—are reviewed in Chap. 13 (Molecular Quantum Spin- tronics).Finally,Chap.14isdevotedtoatotallydifferenttopic,theapplication(by meansofthemagnetocaloriceffect)ofmolecularmagnetstoverylowtemperature refrigerantsinmicrodevices. Inclosing,theEditorswishtoexpresstheirpleasureathavingworkedwiththe authors, and we would like to thank each and everyone of them for their warm responseandfullco-operation. Zaragoza,Spain J.Bartolomé F.Luis J.F.Fernández Contents PartI TunnelingofSingleMoleculeMagnets 1 FromQuantumRelaxationtoResonantSpinTunneling . . . . . . 3 JavierTejada 1.1 HistoricNotes . . . . . . . . . . . . . . . . . . . . . . . . . . . 3 1.2 EarlyExperimentsonMagneticTunnelingattheUniversity ofBarcelona . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5 1.3 ExperimentsonMn-12 . . . . . . . . . . . . . . . . . . . . . . 8 1.4 Conclusion . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 12 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 13 2 QuantumTunnelingoftheCollectiveSpinsofSingle-Molecule Magnets:FromEarlyStudiestoQuantumCoherence . . . . . . . 17 BernardBarbara 2.1 Introduction . . . . . . . . . . . . . . . . . . . . . . . . . . . . 17 2.2 PrehistoryandHistory . . . . . . . . . . . . . . . . . . . . . . . 18 2.2.1 Micro-SQUIDMeasurements . . . . . . . . . . . . . . . 22 2.2.2 Mn -ac,TheFirstSingleMolecularMagnet . . . . . . . 22 12 2.3 QuantumTunnelinginSingleMoleculeMagnets . . . . . . . . . 24 2.3.1 SingleMoleculeMagnets:BasicProperties . . . . . . . . 24 2.3.2 FirstEvidences. . . . . . . . . . . . . . . . . . . . . . . 26 2.3.3 MainEvidences . . . . . . . . . . . . . . . . . . . . . . 28 2.4 TheoryandComparisonswithExperiments. . . . . . . . . . . . 33 2.4.1 ResonanceConditions . . . . . . . . . . . . . . . . . . . 33 2.4.2 QuantumFluctuationsandBarrierErasing . . . . . . . . 34 2.4.3 TunnelSplittings,Spin-ParityandObservationofMQTM 34 2.4.4 QuantumTunnelingandSpin-Bath . . . . . . . . . . . . 36 2.5 QuantumTunnelingandCoherenceinSingleIonMagnets . . . . 44 2.5.1 FirstEvidenceofMQTMinSIMsandComparison withSMMs . . . . . . . . . . . . . . . . . . . . . . . . 44 2.5.2 FirstEvidenceofMQCMinSIMs,PavingtheWay forSMMs . . . . . . . . . . . . . . . . . . . . . . . . . 47 ix x Contents 2.6 QuantumCoherenceinSingleMoleculeMagnets . . . . . . . . 50 2.7 ConclusionandPerspectives. . . . . . . . . . . . . . . . . . . . 54 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 55 3 SpinTunnelinginMagneticMoleculesThatHaveFullorPartial MechanicalFreedom . . . . . . . . . . . . . . . . . . . . . . . . . . 61 EugeneM.Chudnovsky 3.1 Introduction . . . . . . . . . . . . . . . . . . . . . . . . . . . . 61 3.2 NanomechanicsofaTwo-StateSpinSystemRotatingAbout aFixedAxis . . . . . . . . . . . . . . . . . . . . . . . . . . . . 64 3.2.1 QuantumMechanicsofaTwo-StateSpinSystem. . . . . 64 3.2.2 RenormalizationoftheSpinTunnelSplitting inaNano-oscillator . . . . . . . . . . . . . . . . . . . . 65 3.3 FreeQuantumRotatorwithaTwo-StateMacrospin . . . . . . . 67 3.3.1 AnomalousCommutationRelations . . . . . . . . . . . . 67 3.3.2 RotatingTwo-StateSpinSystem . . . . . . . . . . . . . 70 3.3.3 GroundState . . . . . . . . . . . . . . . . . . . . . . . . 72 3.4 Conclusions . . . . . . . . . . . . . . . . . . . . . . . . . . . . 74 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 75 4 AMicroscopicandSpectroscopicViewofQuantumTunneling ofMagnetization . . . . . . . . . . . . . . . . . . . . . . . . . . . . 77 JunjieLiu,EnriquedelBarco,andStephenHill 4.1 SpinHamiltonian . . . . . . . . . . . . . . . . . . . . . . . . . 77 4.1.1 Giant-SpinApproximationHamiltonian . . . . . . . . . 78 4.1.2 Multi-SpinHamiltonian . . . . . . . . . . . . . . . . . . 82 4.2 QuantumTunnelingofMagnetizationinHigh-SymmetryMn 3 Single-MoleculeMagnets . . . . . . . . . . . . . . . . . . . . . 83 4.2.1 TheMn Single-MoleculeMagnet . . . . . . . . . . . . 84 3 4.2.2 QTMSelectionRulesinMn . . . . . . . . . . . . . . . 85 3 4.2.3 TheInfluenceofDisorderonQTM . . . . . . . . . . . . 88 4.2.4 BerryPhaseInterferenceinTrigonalSymmetry . . . . . 92 4.3 QuantumTunnelingofMagnetizationintheHigh-SymmetryNi 4 Single-MoleculeMagnet. . . . . . . . . . . . . . . . . . . . . . 93 4.3.1 TheNi Single-MoleculeMagnet . . . . . . . . . . . . . 93 4 4.3.2 QuantumTunnelingofMagnetizationintheNi SMM. . 96 4 4.3.3 Disorder . . . . . . . . . . . . . . . . . . . . . . . . . . 98 4.4 QuantumTunnelingofMagnetizationinLow-SymmetryMn 4 Single-MoleculeMagnets . . . . . . . . . . . . . . . . . . . . . 99 4.4.1 TheMn Single-MoleculeMagnets . . . . . . . . . . . . 99 4 4.4.2 EPRandQTMSpectroscopyinMn SMMswithand 4 WithoutSolvent . . . . . . . . . . . . . . . . . . . . . . 100 4.4.3 BerryPhaseInterferenceinMn -Bet . . . . . . . . . . . 103 4 4.5 SummaryandOutlook . . . . . . . . . . . . . . . . . . . . . . . 106 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 108

See more

The list of books you might like