loading

Logout succeed

Logout succeed. See you again!

ebook img

Silicone Surface Science PDF

pages398 Pages
release year2012
file size13.008 MB
languageEnglish

Preview Silicone Surface Science

Advances in Silicon Science ADVANCES IN SILICON SCIENCE VOLUME4 SeriesEditor: JANISMATISONS GelestInc.,11EastSteelRoad,Morrisville,PA19067,USA AdvancesinSiliconScienceisabookserieswhichpresentsreviewsofthepresentand futuretrendsinsiliconscienceandwillbenefitthoseinchemistry,physics,biomedical engineering, and materials science. It is aimed at all scientists at universities and in industrywhowishtokeepabreastofadvancesinthetopicscovered. SeriesEditor Prof.JanisMatisons SeniorR&DManager GelestInc 11EastSteelRoad Morrisville Pennsylvania19067 USA [email protected] Volume4 SiliconeSurfaceScience VolumeEditors MichaelJ.Owen PetarR.Dvornic MichiganMolecularInstitute Midland,MI USA Forfurthervolumes: www.springer.com/series/7926 Michael J. Owen (cid:2) Petar R. Dvornic Editors Silicone Surface Science Editors MichaelJ.Owen PetarR.Dvornic MichiganMolecularInstitute MichiganMolecularInstitute Midland,MI Midland,MI USA USA Chapter6wascreatedwithinthecapacityofanUSgovernmentalemploymentandthereforeisinthe publicdomain. ISSN1875-3108 ISSN1875-3086(electronic) AdvancesinSiliconScience ISBN978-94-007-3875-1 ISBN978-94-007-3876-8(eBook) DOI10.1007/978-94-007-3876-8 SpringerDordrechtHeidelbergNewYorkLondon LibraryofCongressControlNumber:2012939196 ©SpringerScience+BusinessMediaDordrecht2012 Thisworkissubjecttocopyright.AllrightsarereservedbythePublisher,whetherthewholeorpartof thematerialisconcerned,specificallytherightsoftranslation,reprinting,reuseofillustrations,recitation, broadcasting,reproductiononmicrofilmsorinanyotherphysicalway,andtransmissionorinformation storageandretrieval,electronicadaptation,computersoftware,orbysimilarordissimilarmethodology nowknownorhereafterdeveloped.Exemptedfromthislegalreservationarebriefexcerptsinconnection with reviews or scholarly analysis or material supplied specifically for the purpose of being entered and executed on a computer system, for exclusive use by the purchaser of the work. Duplication of this publication or parts thereof is permitted only under the provisions of the Copyright Law of the Publisher’slocation,initscurrentversion,andpermissionforusemustalwaysbeobtainedfromSpringer. PermissionsforusemaybeobtainedthroughRightsLinkattheCopyrightClearanceCenter.Violations areliabletoprosecutionundertherespectiveCopyrightLaw. Theuseofgeneraldescriptivenames,registerednames,trademarks,servicemarks,etc.inthispublication doesnotimply,evenintheabsenceofaspecificstatement,thatsuchnamesareexemptfromtherelevant protectivelawsandregulationsandthereforefreeforgeneraluse. Whiletheadviceandinformationinthisbookarebelievedtobetrueandaccurateatthedateofpub- lication,neithertheauthorsnortheeditorsnorthepublishercanacceptanylegalresponsibilityforany errorsoromissionsthatmaybemade.Thepublishermakesnowarranty,expressorimplied,withrespect tothematerialcontainedherein. Printedonacid-freepaper SpringerispartofSpringerScience+BusinessMedia(www.springer.com) Preface Godmadethebulk;surfaceswereinventedbythedevil WolfgangPauli1 It is somewhatsurprising,in our opinion,that this book,to thebest of our knowl- edge, is the first to be devoted to the surface properties and behavior of silicone polymers.Thesituationisallthemoreperplexingwhenoneconsidersthatsurface- relatedapplicationshaveconsistentlyaccountedforthemajorpartofthecommer- cialsuccessofsiliconessincetheestablishmentofthisindustryintheearly1940s. The importance of surfaces and interfacial phenomena cannot be overempha- sized.Whenanytwomaterialsarebroughttogetheritistheirsurfacesthatinitially matterandtheirinterfacialinteractionsthatneedtobestudiedandunderstoodfirst. Therefore,inordertocontributetothis,inthisbookweattempttopresentabroad overviewofthestate-of-the-artofsiliconesurfacesciencebyagroupofwidelyrec- ognizedexpertsintheirfieldssummarizingboththehistoricaldevelopmentandthe currentprogressineachselectedarea.Withalmost70yearsofscientificandtech- nologicalinterestinsiliconeswecanhardlyclaimtoberigorouslycomprehensive, butwearesurethatthemostexcitingdevelopmentsinthisfieldtodayarecovered inthisvolume. Muchofthecontentofthisbookdealswithpolydimethylsiloxane(PDMS)since it has been the mainstay of the silicone industry from its very beginnings to the present day. Furthermore, looking into the future, while anticipatingcontinued in- terest in and development of other polymers derived from organosilicon entities, thereisnoreasonnottobelievethatthescienceandapplicationsofPDMSandre- latedorganosiloxanepolymerswillcontinuetogrowandplayasimportantaroleas theyhaveinthepast. Asiscommoninthefieldofsilicon-containingpolymers,weusethetermsili- conetodescribepolymerswhosebackboneissiloxane,i.e.alternatingarrangement ofsiliconandoxygenatoms,withpendentorganicgroupsattachedtothatbackbone. Consequently,polyhedraloligomericsilsesquioxanes(POSS),whichcertainlymeet 1Quotedin“Growth,DissolutionandPatternFormationinGeosystems”(1999)byBjornJamtveit andPaulMeakin,p.291. v vi Preface the“alternatingsiloxanebonds”requirement,arenotusuallyconsidered“silicones”, becauseoftheirinsufficientmolecularweightsandfundamentallydifferentmacro- scopicproperties.Nevertheless,weconsidertheseoligomerstobeapropersubject forinclusioninthisvolumebecauseoftheircriticalimportancetosiliconesurface scienceasexplainedindetailintwochaptersdealingwithPOSSderivatives. Whatmightappeartosometobeasomewhatcapriciouschapterorderisbased on our attemptto marry two seemingly “incompatible”concepts: (i) a progressive shiftfromfundamentalstomoreappliedtopics,and(ii)adevelopmentfrom“pure” PDMStootherimportant,surface-activesiliconessuchasfluorosiliconesandmod- ifiedmaterialssuchassurfactantsandcouplingagents.Thebookopenswithagen- eralintroductiontosiliconesurfaceswithanemphasisonthesurfacepropertiesof PDMS.Followingthis,inChap.2AhnandDhinojwaladescribethesumfrequency generationvibrationalspectroscopyofsiliconesurfacesandinterfaces,arelatively recentlyintroducedtechniquethat has providedconsiderablenew insightintosur- facestructureandmostnotablytoburiedinterfacesaswell.Genzerandco-workers havemadegreatstridesincreatingdifferentfunctionalitiesonsiliconesurfacesand their contributions are reviewed in Chap. 3. Superhydrophobic surfaces have fea- tured strongly in the last decade, and McCarthy et al. review their silane/siloxane studiesofthistopicinChap.4.Chapters5and6dealwithfluorine-containingsili- coneswhereGanachaudandAmeduriandtheircolleaguesreviewstructure/property relationshipsinfluorosiliconesandTutejaandMabrycontributeachapteronfluoro- POSSmaterialswhicharehighlyrelevanttotheearliertopicofsuperhydrophobic- ity,respectively.Ourstronginterestinfluorosiliconesderivesfromtheirpotentialto producesignificantlylowersurfaceenergiesthanconventionalPDMSsurfaces. Langmuir trough investigations of silicones have been of interest since surface studiesofsiliconesbegan.InChap.7EskerandYuprovideasummaryofthistopic withanupdateofrecentworksthatoffersanotherfacetofthegrowingimportance ofPOSScompoundstoorganosiliconsurfacesciencetoday.Atopicofhigh-interest tocurrentsiloxanesciencewithconsiderablesurface-relatedimplicationsisthein- teractionofproteinsandsilicon-basedmaterialswhichisthesubjectofChap.8by Clarsonandco-workers.Thisisfollowedbyareviewofsiliconesurfactantfunda- mentalsandapplicationsbySnowandPetroffinChap.9,whileMatisons’Chap.10 deals with the adsorption of polymeric siloxanes on glass surfaces and their cou- pling behavior as well as with more conventional silane coupling agents. Surface treatments such as plasma and corona have been widely exploited in silicone sur- face modification.These are summarized in Chap. 11 by Hillborg and Gedde (see alsoChap.3whichdealswithaspectsofthistopic). Analyticaltechniquesareself-evidentlycentraltounderstandingofsiliconesur- face behavior. A review of these studies with emphasis on X-ray photoelectron spectroscopy (XPS), secondary ion mass spectrometry (SIMS), scanning electron microscopy(SEM)andscanningprobemicroscopy(SPM)isprovidedbyLeadley, O’HareandMcMillaninChap.12.Finally,weclosewithanoutlineofsomeimpor- tantsurfaceapplicationsofsiliconesrelatingtoboththescienceandtechnologyof siliconesurfaces.Someoftheseapplicationsarealsoincludedinseveraloftheear- lierchapters,underliningadominantthemeofthisbook,therelationshipbetween Preface vii thestructureandsurfacepropertiesofsiliconesandtheirutilizationinvariousevery- dayaswellasmoresophisticatedapplications. A variety of authors contributed different perspectives to this work, including academicandindustrialspecialistsfromEuropeandNorthAmerica.Wesincerely thankallofthemfortheirimpressivecontributionsandtheirpatienceandpersever- ance throughout the process of bringing this book to fruition. We are particularly gratefultoourpublishingeditor,Dr.SoniaOjoandherSpringercolleaguesfortheir experthelpduringthepreparationofthemanuscriptandtoDonatasAkmanavicˇius ofVTeXUABintherealizationofthisfinishedwork. Midland,MI,USA MichaelJ.Owen PetarR.Dvornic Contents 1 GeneralIntroductiontoSiliconeSurfaces . . . . . . . . . . . . . . . 1 MichaelJ.OwenandPetarR.Dvornic 1.1 Introduction . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1 1.2 LiquidSurfaceTension . . . . . . . . . . . . . . . . . . . . . . . 4 1.3 WaterContactAngleStudies . . . . . . . . . . . . . . . . . . . . 7 1.4 SolidSurfaceEnergyDetermination . . . . . . . . . . . . . . . . 10 1.5 ContactMechanicsApproach . . . . . . . . . . . . . . . . . . . . 12 1.6 LangmuirTroughStudies . . . . . . . . . . . . . . . . . . . . . . 15 1.7 OtherSilicones . . . . . . . . . . . . . . . . . . . . . . . . . . . . 17 1.8 ConcludingRemarks. . . . . . . . . . . . . . . . . . . . . . . . . 19 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 19 2 SumFrequencyGenerationVibrationalSpectroscopyofSilicone Surfaces&Interfaces . . . . . . . . . . . . . . . . . . . . . . . . . . 23 DongchanAhnandAliDhinojwala 2.1 Introduction . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 23 2.2 Fundamentals . . . . . . . . . . . . . . . . . . . . . . . . . . . . 24 2.2.1 TheoryofSurface-SensitiveSFG . . . . . . . . . . . . . . 24 2.2.2 ExperimentalSet-upandSampleConsiderations . . . . . . 28 2.2.3 Simulation . . . . . . . . . . . . . . . . . . . . . . . . . . 30 2.2.4 SiliconeCureSystems . . . . . . . . . . . . . . . . . . . . 31 2.3 ApplicationsofSFGtoSiliconeSurfacesandInterfaces . . . . . . 32 2.3.1 SiliconeSurfaceOrientationandRearrangement . . . . . . 32 2.3.2 FrictionandLubrication . . . . . . . . . . . . . . . . . . . 34 2.3.3 Adhesion . . . . . . . . . . . . . . . . . . . . . . . . . . . 42 2.3.4 Sensors . . . . . . . . . . . . . . . . . . . . . . . . . . . . 50 2.4 ConclusionsandFutureDirections . . . . . . . . . . . . . . . . . 51 2.4.1 Materials . . . . . . . . . . . . . . . . . . . . . . . . . . . 51 2.4.2 InstrumentationandTechniques . . . . . . . . . . . . . . . 53 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 54 ix x Contents 3 Creating Functional Materials by Chemical and Physical FunctionalizationofSiliconeElastomerNetworks . . . . . . . . . . . 59 Jan Genzer, Ali E. O˝zçam, Julie A. Crowe-Willoughby, and KirillEfimenko 3.1 Introduction . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 59 3.2 PhysicalModificationofSENSurfaces . . . . . . . . . . . . . . . 62 3.3 ControllingMolecularandMacromolecularPackingUsingSENs . 67 3.4 TurningFlatSENsintoTopographicallyCorrugatedSurfaces . . . 74 3.5 SENasaMaterialPlatformforCreatingResponsive/“Smart” Materials . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 78 3.6 AQuestTowardsUniversalCoatingLayers . . . . . . . . . . . . . 85 3.7 Conclusions . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 89 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 90 4 UsingSurface-AttachedOrganosilanestoControlandUnderstand HydrophobicityandSuperhydrophobicity . . . . . . . . . . . . . . . 95 Joseph W. Krumpfer, Lichao Gao, Alexander Y. Fadeev, and ThomasJ.McCarthy 4.1 Introduction . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 95 4.2 MonofunctionalSilanes:MolecularTopographyandFlexibility ContributetoContactAngleHysteresis . . . . . . . . . . . . . . . 96 4.3 MethylchlorosilanesReacttoFormSuperhydrophobicSurfaces . . 102 4.3.1 Methyltrichlorosilane and a Perfectly Hydrophobic Surface[32] . . . . . . . . . . . . . . . . . . . . . . . . . 104 4.3.2 The(CH ) SiCl/SiCl Azeotrope[34] . . . . . . . . . . . 105 3 3 4 4.4 “Unreactive”SiliconesReactwithInorganicSurfaces . . . . . . . 109 4.5 ClosingComments. . . . . . . . . . . . . . . . . . . . . . . . . . 113 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 113 5 ComparisonofSurfaceandBulkPropertiesofPendantandHybrid Fluorosilicones . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 115 Cedric Pasquet, Claire Longuet, Siska Hamdani-Devarennes, BrunoAmeduri,andFrançoisGanachaud 5.1 Introduction . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 115 5.2 SomeInsightsonFluorosiliconeSynthesis . . . . . . . . . . . . . 117 5.2.1 SynthesisofPendantFluorosilicones . . . . . . . . . . . . 118 5.2.2 SynthesisofHybridFluorosilicones. . . . . . . . . . . . . 121 5.3 SurfaceProperties . . . . . . . . . . . . . . . . . . . . . . . . . . 125 5.3.1 SurfaceTensionofPendantFluorosilicones. . . . . . . . . 125 5.3.2 SurfaceTensionofHybridFluorosilicones . . . . . . . . . 133 5.3.3 ConclusionstoSect.5.3 . . . . . . . . . . . . . . . . . . . 134 5.4 ThermalPropertiesofFluorosilicones . . . . . . . . . . . . . . . . 134 5.4.1 PendantFluorosilicones . . . . . . . . . . . . . . . . . . . 135 5.4.2 HybridFluorosilicones . . . . . . . . . . . . . . . . . . . 136 5.4.3 ConclusionstoSect.5.4 . . . . . . . . . . . . . . . . . . . 146 Contents xi 5.5 SwellingPropertiesofFluorosilicones . . . . . . . . . . . . . . . 146 5.5.1 PendantFluorosilicones . . . . . . . . . . . . . . . . . . . 146 5.5.2 HybridFluorosilicones . . . . . . . . . . . . . . . . . . . 148 5.5.3 ConclusionstoSect.5.5 . . . . . . . . . . . . . . . . . . . 152 5.6 MechanicalPropertiesofFluorosilicones . . . . . . . . . . . . . . 152 5.6.1 PendantFluorosilicones . . . . . . . . . . . . . . . . . . . 152 5.6.2 HybridFluorosilicones . . . . . . . . . . . . . . . . . . . 161 5.6.3 ConclusionstoSect.5.6 . . . . . . . . . . . . . . . . . . . 165 5.7 NewAvenuesinFluorosiliconeElastomerSynthesis . . . . . . . . 165 5.7.1 RandomCopolymers . . . . . . . . . . . . . . . . . . . . 165 5.7.2 BlockCopolymers . . . . . . . . . . . . . . . . . . . . . . 167 5.8 Conclusions . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 171 AppendixA DefinitionandMeasurementsofSurfaceTensionforSoft Polymers . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 171 A.1 DefinitionofSurfaceTension . . . . . . . . . . . . . . . . 171 A.2 MeasurementofLiquidSurfaceTensions . . . . . . . . . . 172 A.3 MeasurementofSolidSurfaceTensions . . . . . . . . . . 173 Appendix B Swelling Measurements, Solubility Parameters and PDMSCase . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 174 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 175 6 TheDesignofNon-wettingSurfaceswithFluoroPOSS . . . . . . . . 179 AnishTutejaandJosephM.Mabry 6.1 Introduction . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 179 6.1.1 Non-wettingSurfaces . . . . . . . . . . . . . . . . . . . . 179 6.1.2 FluoroPOSS . . . . . . . . . . . . . . . . . . . . . . . . . 180 6.1.3 DesignParameters . . . . . . . . . . . . . . . . . . . . . . 182 6.2 PreparationofMaterials . . . . . . . . . . . . . . . . . . . . . . . 184 6.2.1 FluorodecylPOSSSynthesis . . . . . . . . . . . . . . . . 184 6.2.2 FluoroPOSSCompositePreparation . . . . . . . . . . . . 185 6.3 CharacterizationTechniques . . . . . . . . . . . . . . . . . . . . . 185 6.3.1 ContactAngleAnalysis . . . . . . . . . . . . . . . . . . . 185 6.3.2 Microscopy . . . . . . . . . . . . . . . . . . . . . . . . . 186 6.4 FluoroPOSSMaterialProperties . . . . . . . . . . . . . . . . . . 186 6.4.1 FluoroPOSSCompounds . . . . . . . . . . . . . . . . . . 186 6.4.2 FluoroPOSSComposites . . . . . . . . . . . . . . . . . . 186 6.5 Conclusions . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 190 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 190 7 LangmuirMonolayersofSiloxanesandSilsesquioxanes . . . . . . . 195 AlanR.EskerandHyukYu 7.1 Introduction . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 195 7.2 SiliconeLangmuirFilms . . . . . . . . . . . . . . . . . . . . . . 195 7.2.1 SurfacePressure-AreaperRepeatUnit(Π-A)Isotherms ofPDMSLangmuirFilms . . . . . . . . . . . . . . . . . . 196 7.2.2 ViscoelasticPropertiesofPDMSLangmuirFilms . . . . . 199

See more

The list of books you might like