Logout succeed
Logout succeed. See you again!

Three Dimensional Solar Cells Based on Optical Confinement Geometries PDF
Preview Three Dimensional Solar Cells Based on Optical Confinement Geometries
Springer Theses Recognizing Outstanding Ph.D. Research For furthervolumes: http://www.springer.com/series/8790 Aims and Scope The series “Springer Theses” brings together a selection of the very best Ph.D. theses from around the world and across the physical sciences. Nominated and endorsed by two recognized specialists, each published volume has been selected foritsscientificexcellenceandthehighimpactofitscontentsforthepertinentfield of research. For greater accessibility to non-specialists, the published versions includeanextendedintroduction,aswellasaforewordbythestudent’ssupervisor explainingthespecialrelevanceoftheworkforthefield.Asawhole,theserieswill provide a valuable resource both for newcomers to the research fields described, and for other scientists seeking detailed background information on special questions. Finally, it provides an accredited documentation of the valuable contributionsmadebytoday’syoungergenerationofscientists. Theses are accepted into the series by invited nomination only and must fulfill all of the following criteria (cid:129) TheymustbewritteningoodEnglish. (cid:129) ThetopicshouldfallwithintheconfinesofChemistry,Physics,EarthSciences and related interdisciplinary fields such as Materials, Nanoscience, Chemical Engineering,ComplexSystemsandBiophysics. (cid:129) Theworkreportedinthethesismustrepresentasignificantscientificadvance. (cid:129) Ifthethesisincludespreviouslypublishedmaterial,permissiontoreproducethis mustbegainedfromtherespectivecopyrightholder. (cid:129) They must have been examined and passed during the 12 months prior to nomination. (cid:129) Each thesis should include a foreword by the supervisor outlining the signifi- canceofitscontent. (cid:129) The theses should have a clearly defined structure including an introduction accessibletoscientistsnotexpertinthatparticularfield. Yuan Li Three Dimensional Solar Cells Based on Optical Confinement Geometries Doctoral Thesis accepted by Wake Forest University, USA Author Supervisor YuanLi DavidCarroll DepartmentofPhysics DepartmentofPhysics WakeForestUniversity WakeForestUniversity Winston-Salem,NC,USA Winston-Salem,NC,USA ISSN2190-5053 ISSN2190-5061(electronic) ISBN978-1-4614-5698-8 ISBN978-1-4614-5699-5(eBook) DOI10.1007/978-1-4614-5699-5 SpringerNewYorkHeidelbergDordrechtLondon LibraryofCongressControlNumber:2012952095 #SpringerScience+BusinessMediaNewYork2013 Thisworkissubjecttocopyright.AllrightsarereservedbythePublisher,whetherthewholeorpart of the material is concerned, specifically the rights of translation, reprinting, reuse of illustrations, recitation,broadcasting,reproductiononmicrofilmsorinanyotherphysicalway,andtransmissionor informationstorageandretrieval,electronicadaptation,computersoftware,orbysimilarordissimilar methodologynowknownorhereafterdeveloped.Exemptedfromthislegalreservationarebriefexcerpts inconnectionwithreviewsorscholarlyanalysisormaterialsuppliedspecificallyforthepurposeofbeing enteredandexecutedonacomputersystem,forexclusiveusebythepurchaserofthework.Duplication ofthispublicationorpartsthereofispermittedonlyundertheprovisionsoftheCopyrightLawofthe Publisher’s location, in its current version, and permission for use must always be obtained from Springer.PermissionsforusemaybeobtainedthroughRightsLinkattheCopyrightClearanceCenter. ViolationsareliabletoprosecutionundertherespectiveCopyrightLaw. The use of general descriptive names, registered names, trademarks, service marks, etc. in this publicationdoesnotimply,evenintheabsenceofaspecificstatement,thatsuchnamesareexempt fromtherelevantprotectivelawsandregulationsandthereforefreeforgeneraluse. While the advice and information in this book are believed to be true and accurate at the date of publication,neithertheauthorsnortheeditorsnorthepublishercanacceptanylegalresponsibilityfor anyerrorsoromissionsthatmaybemade.Thepublishermakesnowarranty,expressorimplied,with respecttothematerialcontainedherein. Printedonacid-freepaper SpringerispartofSpringerScience+BusinessMedia(www.springer.com) Supervisor’s Foreword Three-dimensional(3D)opticalgeometriesarebecomingmoreandmorecommon intheliteratureandlexiconofsolarcells.Designedtoimprovetheoverallperfor- mance of a general absorber by employing optical confinement, the concept is meant to approach the thermodynamic limits allowed by the absorbers chosen. Currently there are several geometries under study, fromspheresto boxes. Inthis work, the principles for fiber and tube geometries are worked out in detail. However, as we show through a combination of optical modeling as well as data directlyfromsuchdevices,theprinciplesuncoveredarequitegeneralandprovide an important insight into the challenges of using such geometries with real, com- merciallyviableabsorbers. Specifically,thisworkdescribesandrevealsthebasicoperationalnuancesof3D photovoltaics using three standard tools found in the field: equivalent circuit models, optical path ray tracing in the cavity, and absorber spectral response. These tools help us explain our experimentally observed absorption profiles and correspondingJsc,Voc,fillingfactors,andEQEforsuchdevices.Inthiswork,they are applied toindividual optical confinementgeometrydevices, integrated optical confinement geometrydevices, and hybrid optical confinementgeometry devices. Finally, we discuss the overall picture of these fascinating approaches to high- efficiencysolarandpointthewaytotheirpotentialinsolarfarms,etc. April2012 DavidCarroll v Acknowledgements First, I thank my supervisor Prof. David Carroll, who allowed me the freedom to pursue what interested me. During times when I would hover in a valley of scientific puzzle, hewas always able toguide me through it.Without his support, Icouldnothavecompletedandreleasedmyworkofthepastthreeandhalfyears. IwouldliketoshowmygratitudetoProf.Kim-ShapiroandProf.Williams,who are my RAC committee. They gave me many great suggestions on my research. I am indebted to many people within Wake Forest University for making this projectpossible. My wife Dan Xue, the most beautiful and kindest girl I have met, not only prepareddeliciousfoodforme,butalsohelpedmewithcodingandwebdevelop- ment. My biggest contribution in this work — a web-based photovoltaic analysis platform(OPVAP,www.opvap.com)—hasmainlycomefromherassistance. I would also like to thank the following members of Prof. Carroll’s group for beingexcellentteammates:Wanyi,Wenxiao,Rob,Eric,Bob,Yonghua,andespe- cially Huihui Huang and Mingjun Wang. If, say, Dr. Carroll guided me towards thedirectionofbrightness,theyarethepersonswhowentthroughthevalleywith me.IespeciallyappreciatethecontributionandleadershipofMingjunonthework oftube-basedDSSC,makingthisthesismorecomprehensiveinthestudyofhybrid 3Dsolarcell. ThecollaboratorsDeweiZhao,XiangWan,JunmingLi,Pro f.FujunZhang,and Prof.XiaoweiSunhaveprovidedassistanceandsupportonmanyoccasions.Xiang WanprovidedstrongsupportinMathematics,whichhasbeenpublishedinPRB. Anotherfriend,onewhoImustuseaseparateparagraphtoexpressmythanks,is Dr.XiaoXu.WhenIcametoWakeForestthreeyearsago,hepickedmeupfrom the airport with another friend, and then, like a “Survival Manual,” he introduced me to new friends, took me shopping and to a party, even gave suggestions for researchandcoding.Ihopemorecontributionsandcollaborationswillcomefrom ourfriendshipinthefuture. Finally,Ithankmyparents.Theyhavealwayssupportedmychoices,anddotheir best to assist me in whatever problem Imeet.Also, I want toextend thanks toall relativesandfriends,pastandcurrent,forallowingmetofinishmyPh.Dsmoothly. vii Contents 1 Introduction. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1 1.1 SolarEnergyandSolarCell. . . . . . . . . . . . . . . . . . . . . . . . . . . . 1 1.2 PhysicsofPhotovoltaics. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3 1.2.1 PhotovoltaicEffect. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3 1.2.2 LightDistributioninMultilayers. . . . . . . . . . . . . . . . . . . 7 1.2.3 Drift,DiffusionandRecombination ofChargeCarrier. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 14 1.2.4 EquivalentCircuit. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 17 1.3 DevelopmentofOpticalConfinementGeometry SolarCell. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 25 1.3.1 SeveralApproachestoImproveOptical PerformanceofOrganicPhotovoltaics. . . . . . . . . . . . . . . 27 1.3.2 ArchitecturesofOpticalConfinement GeometrySolarCell. . . . . . . . . . . . . . . . . . . . . . . . . . . . 29 1.3.3 TheoreticalModelsandSimulation of3DSolarCells. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 34 References. . . . . . . . . .. . . . . . . . . . . . . .. . . . . . . . . . . . .. . . . . . . . 35 2 EquivalentCircuit. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39 2.1 EquivalentCircuitModel. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39 2.2 HeterogeneousIllumination. . . . . . . . . . . . . . . . . . . . . . . . . . . . 45 2.3 DependenceofLightIlluminationIntensity. . . . . . . . . . . . . . . . . 51 References. . . . . . . . . .. . . . . . . . . . . . . .. . . . . . . . . . . . .. . . . . . . . 55 3 OpticalPathinCavity. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 59 3.1 OpticalPathModel. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 59 3.1.1 IncidenceandTransmission. . . . . . . . . . . . . . . . . . . . . . . 60 3.1.2 AttenuationandAbsorption(Energy). . . . . . . . . . . . . . . . 63 3.2 SimulationMethod. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 64 3.3 DependenceofIncidentAngleandArchitecture. . . . . . . . . . . . . 67 References. . . . . . . . . .. . . . . . . . . . . . . .. . . . . . . . . . . . .. . . . . . . . 71 ix x Contents 4 SpectralResponse. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 73 4.1 TransferMatrixModelforOpticalConfinement Geometry. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 73 4.2 ActiveLayerThicknessDependence. . . . . .. . . . . .. . . . . . .. . . 76 4.3 AbsorptionandEQE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 77 References. . . . . . . . . .. . . . . . . . . . . . . .. . . . . . . . . . . . .. . . . . . . . 79 5 IndividualOpticalConfinementGeometryDevice. . . . . . . . . . . . . . 81 5.1 FiberBasedSolarCellwithDipCoatingITO. . . . . . . . . . . . . . . 81 5.1.1 FabricationofFiber-BasedSolarCell. . . . . . . . . . . . . . . 83 5.1.2 PerformanceofFiber-BasedSolarCell. . . . . . . . . . . . . . 85 5.2 ITO-FreeTubeBasedSolarCell. . . . . . . . . . . . . . . . . . . . . . . . . 93 5.3 TandemOCGPV. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 98 5.3.1 SerialConnection. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 98 5.3.2 ParallelConnection. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 99 References. . . . . . . . . .. . . . . . . . . . . . . .. . . . . . . . . . . . .. . . . . . . . 101 6 IntegratedOpticalConfinementGeometryDevice. . . . . . . . . . . . . . 105 6.1 FiberBundles. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 105 6.2 AlignedStampedFiberDevices. . . . . . . . . . . . . . . . . . . . . . . . . 105 6.2.1 AlignedStampedFiber(Dome)Devices. . . . . . . . . . . . . 106 6.2.2 AlignedStampedFiberDevices(Long). . . . . . . . . . . . . . 110 6.3 Cones-BasedFiberDevice. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 111 6.4 ZnONano-rodInvertedSolarCell. . . . . . . . . . . . . . . . . . . . . . . 113 References. . . . . . . . . .. . . . . . . . . . . . . .. . . . . . . . . . . . .. . . . . . . . 120 7 HybridOpticalConfinementGeometryDevice. . . . . . . . . . . . . . . . 123 7.1 Photovoltaic-ThermalSolarEnergyCollectors BasedonOpticalTubes. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 123 7.1.1 FabricationofTube-BasedPV/TDevices. . . . . . . . . . . . . 125 7.1.2 PerformanceofTube-BasedPV/TDevices. . . . . . . . . . . . 125 7.2 Dye-SensitizedTube-BasedSolarCell. . . . . . . . . . . . . . . . . . . . 129 7.2.1 FabricationofTube-BasedDSSC. . . . . . . . . . . . . . . . . . 130 7.2.2 PerformanceofTube-BasedDSSC. . . . . . . . . . . . . . . . . 132 7.3 Fiber-BasedHybridSolarPowerSystem. . . . . . . . . . . . . . . . . . . 134 References. . . . . . . . . .. . . . . . . . . . . . . .. . . . . . . . . . . . .. . . . . . . . 137 8 Conclusion. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 141 8.1 Summary. . . .. . . . .. . . .. . . .. . . . .. . . .. . . .. . . . .. . . .. . . 141 8.2 SuggestionsfortheFutureInvestigations. . . . . . . . . . . . . . . . . . 141 References. . . . . . . . . .. . . . . . . . . . . . . .. . . . . . . . . . . . .. . . . . . . . 144 9 Appendices. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 145 9.1 InstrumentsandTools. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 145 9.1.1 DipCoater. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 145 9.1.2 RotatingDeposition. . . . . . . . . . . . . . . . . . . . . . . . . . . . 145 9.2 DeviceFabrication. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 145