Logout succeed
Logout succeed. See you again!

α(β,β)-Topological Abelian Groups PDF
Preview α(β,β)-Topological Abelian Groups
GlobalJournalofPureandAppliedMathematics. ISSN0973-1768Volume13,Number6(2017),pp. 2291–2306 ©ResearchIndiaPublications http://www.ripublication.com/gjpam.htm α -Topological Abelian Groups (β,β) AliasB.Khalaf DepartmentofMathematics, CollegeofScience,UniversityofDuhok, Kurdistan-Region,Iraq. HariwanZ.Ibrahim DepartmentofMathematics, FacultyofScience,UniversityofZakho, Kurdistan-Region,Iraq. Abstract Thepurposeofthispaperistointroduceandstudytheconceptofα -topological (β,β) abeliangroup. Alsothesubgroupsinα -topologicalgrouparestudiedandsev- (β,β) eral basic theorems are introduced. The factor group space of α -topological (β,β) groupsisdefinedandsomebasicresultsarepresented. AMSsubjectclassification:Primary: 22A05,22A10;Secondary: 54C05. Keywords: Operations, α -open set, abelian groups, α -topological abelian β (β,β) group. 1. Introduction Topological groups are objects that combine two separate structures-the structure of a topological space and the algebraic structure of a group-linked by the requirement that thegroupoperationsarecontinuouswithrespecttotheunderlyingtopology. Topological groups have the algebraic structure of a group and the topological structure of a topo- logical space and they are linked by the requirement that multiplication and inversion are continuous functions. In the literature the most papers are related to the case of topological groups where group operations are continuous mappings. However, there are also many nice papers and interesting, deep results on other classes of topologized 2292 AliasB.KhalafandHariwanZ.Ibrahim groups. In all these cases continuity play the crucial role. We refer the reader to the monograph [1] and the survey paper [10] where detail information about mentioned classesoftopologizedgroupscanbefound,aswellasreferencesrelatedtothem. In 1965, Njastad [9] initiated and explored a new class of generalized open sets in a topological space called α-open sets and proved that the collection of all α-open sets in (X,τ) is a topology on X, finer that τ. H. Z. Ibrahim [2] introduced and discussed an operation of a topology αO(G) into the power set P(G) of a space G and also he introducedtheconceptofα -opensetsandinvestigatedtherelatedtopologicalproperties β of the associated topology αO(G,τ) and αO(G,τ) by using operation β. These α - β β opensetswereusedtodefinefournewseparationaxiomscalledα T ,α T andα T . β 0 β 1 β 2 2. Preliminaries Through out this paper, we mean by a triple (G,+,τ) an abelian group G equipped with the topology τ. Let A be a subset of a topological space (G,τ). We denote the interior and the closure of a set A by Int(A) and Cl(A) respectively. A subset A of a topological space (G,τ) is called α-open [9] if A ⊆ Int(Cl(Int(A))). By αO(G,τ), we denote the family of all α-open sets of G. An operation β : αO(G,τ) → P(G) [2] is a mapping satisfying the condition, V ⊆ Vβ for each V ∈ αO(G,τ). We call the mapping β an operation on αO(G,τ). A subset A of G is called an α -open set [2] if β foreachpointx ∈ A,thereexistsanα-opensetU ofGcontainingx suchthatUβ ⊆ A. The complement of an α -open set is said to be α -closed. We denote the set of all β β α -open sets of (G,τ) by αO(G,τ) . The α -closure [2] of a subset A of G with an β β β operation β on αO(G) is denoted by α Cl(A) and is defined to be the intersection of β all α -closed sets containing A. An operation β on αO(G,τ) is said to be α-regular if β for every α-open sets U and V of each x ∈ G, there exists an α-open set W of x such thatWβ ⊆ Uβ ∩Vβ. Definition2.1. [5] Anoperationρ : αO(G×G) → P(G×G)issaidtobeα-associated withβ andβ,if(U ×V)ρ = Uβ ×Vβ holdsforeachsetsU,V ∈ αO(G). Definition 2.2. [4] Let (G,τ) be a topological space and x ∈ G, then a subset N of G is said to be α -neighbourhood of x, if there exists an α -open set U in G such that β β x ∈ U ⊆ N. Definition 2.3. [6] Two subsets A and B of a topological space (G,τ) are called α - β separatedif(α Cl(A)∩B)∪(A∩α Cl(B)) = φ. β β Definition 2.4. [6] A subset C of a space G is said to be α -disconnected if there are β nonempty α -separated subsets A and B of G such that C = A ∪ B, otherwise C is β calledα -connected. β Definition 2.5. [6] A set C is called maximal α -connected set if it is α -connected β β and if C ⊆ D ⊆ G where D is α -connected, then C = D. A maximal α -connected β β α -TopologicalAbelianGroups 2293 (β,β) subsetC ofaspaceGiscalledanα -componentofG. β Definition2.6. [2] Atopologicalspace(G,τ)withanoperationβ onαO(G)issaidto be: 1. α T if for any two distinct points x,y ∈ X, there exists an α -open set U such β 0 β thateitherx ∈ U andy ∈/ U ory ∈ U andx ∈/ U. 2. α T if for any two distinct points x,y ∈ X, there exist two α -open sets U and β 1 β V containingx andy,respectively,suchthaty ∈/ U andx ∈/ V. 3. α T if for any two distinct points x,y ∈ X, there exist two α -open sets U and β 2 γ V containingx andy,respectively,suchthatU ∩V = φ. (cid:6) (cid:6) Definition 2.7. [5] A function f : (G,τ) → (G,τ ) is said to be α (cid:6) -open if for (β,β ) (cid:6) (cid:6) anyαβ-opensetAof(G,τ),f(A)isαβ(cid:6)-openin(G,τ ). (cid:6) (cid:6) Definition2.8. [2] Amappingf : (G,τ) → (G,τ )issaidtobeα (cid:6) -continuousif (β,β ) foreachx ofGandeachαβ(cid:6)-opensetV containingf(x),thereexistsanαβ-opensetU suchthatx ∈ U andf(U) ⊆ V. Definition2.9. [2] Amappingf : (G,τ) → (G,τ)issaidtobeα -homeomorphism, (β,β) iff isbijective,α -continuousandf−1 isα -continuous. (β,β) (β,β) Corollary2.10. [6] Afunctionf : G → G(cid:6) isα (cid:6) -continuousifandonlyiff−1(V) (β,β ) (cid:6) isαβ-openinG,foreveryαβ(cid:6)-opensetV inG. Werecallsomeofthewellknowndefinitionsandresultswhichcanbefoundinmost oftextbooksofabstractalgebrawereferto[3]and[8]. Definition 2.11. A group G is an algebraic structure consisting of a non-empty set equippedwithanoperationonitselementsthatsatisfiesfourconditions,namelyclosure, associativity, identity and invertibility. Moreover, if the operation is abelian then G is calledanabeliangroup. (cid:6) (cid:6) Definition2.12. LetGandG beabeliangroups,thenamappingf : G → G iscalled ahomomorphismiff(a+b) = f(a)+f(b)foralla,b ∈ G. Ahomomorphism,being also: abijection,iscalledanisomorphism. (cid:6) (cid:6) (cid:6)(cid:6) Let f : G → G and g : G → G be homomorphisms of abelian groups, then (cid:6)(cid:6) g ◦f : G → G isahomomorphismofabeliangroups. The kernel of the homomorphism f is denoted by ker(f) and ker(f) = {a ∈ G : f(a) = 0}. Definition 2.13. Let G be an abelian group and B ⊆ G. Then B is called a subgroup, ifB isagroupwithrespecttotheexistingoperations. 2294 AliasB.KhalafandHariwanZ.Ibrahim AsubsetC ofanabeliangroupGiscalledsymmetricif−C = C. LetD beasubset ofG,thenD ∩(−D)andD ∪(−D)aresymmetricsubsetsofG. (cid:1)∞ (cid:1)∞ (cid:8)D(cid:9) = n(D ∪(−D)) = ((D ∪(−D))+···+(D ∪(−D))) (cid:2) (cid:3)(cid:4) (cid:5) n=1 n=1 n−times is the smallest subgroup in G containing D (it is called a subgroup generated by the subsetD). Definition2.14. LetB,C besubgroupsofanabeliangroupG,thenG/B isdenotedto be the factor group of the group G by B, that is, the set {a +B : a ∈ A} of cosets with thefollowingoperationofaddition: (a +B)+(c+B) = a +c+B. Themappingπ : G → G/B isdenotestobethenaturalhomomorphism: π(a) = a+B foralla ∈ G. Itisclearthatπ−1(π(S)) = S +B foranysubsetS ⊆ G. Inparticular,ifS = S +B,thenπ−1(π(S)) = S. Theorem 2.15. Let f : A → B and A ⊆ A for i ∈ I. If f−1(f(A )) = A for all i i i i ∈ I except,possibly,onei ∈ I,then 0 (cid:6) (cid:8) (cid:7) (cid:7) f A = f(A ). i i i∈I i∈I Theorem 2.16. Let (G,+) be a group and τ be a topology on G. Then, (G,+,τ) is a topologicalgroupifandonlyifforanyelementsa,bofGandopensetU witha−b ∈ U, thereexistopensetsV andW containinga andb respectivelysuchthatV −W ⊆ U. Recallthefollowingdefinitionsfrom[7]. Definition 2.17. Let (G,∗) be a group and τ be a topology on G. The inversion map is β-α-continuous if given a ∈ G and O ∈ αO(G,τ) such that a−1 ∈ O, then there is U ∈ αO(G,τ)witha ∈ U and(Uβ)−1 ⊆ Oβ,where(Uβ)−1 = {x−1 : x ∈ Uβ}. Definition2.18. Let(G,∗)beagroupandτ beatopologyonG. Themultiplicationis jointlyβ-α-continuousinbothvariablesifgivena,b ∈ GandO ∈ αO(G,τ)suchthat a ∗b ∈ O,thenthereexistU,V ∈ αO(G,τ)witha ∈ U,b ∈ V andUβ ∗Vβ ⊆ Oβ. Definition 2.19. Let (G,∗) be a group and (G,τ) be a topological space. A triple (G,∗,τ) is called a β-α-topological group if the inversion map is β-α-continuous and themultiplicationmapisjointlyβ-α-continuousinbothvariables. 3. α -Topological Group (β,β) Definition3.1. Let(G,+)beabeliangroupandτ beatopologyonG. Atriple(G,+,τ) issaidtobeanα -topologicalgroupifthefollowingconditionsaresatisfied: (β,β) α -TopologicalAbelianGroups 2295 (β,β) 1. For any two elements a,b ∈ G and U ∈ αO(G,τ) such that a +b ∈ U, there β existV,W ∈ αO(G,τ) witha ∈ V,b ∈ W andV +W ⊆ U. β 2. For any element a ∈ G and U ∈ αO(G,τ) such that −a ∈ U, there exists β V ∈ αO(G,τ) witha ∈ V and−V ⊆ U. β The following example shows that the α -topological group need not be a β-α- (β,β) topologicalgroup. Example 3.2. Let (Z ,+ ) be a group and τ be the discrete topology on Z . For each 4 4 4 A ∈ αO(Z ,τ),wedefineβ onαO(Z ,τ)by 4 4 (cid:9) {1,2,3} ifA = {2}, Aβ = Z ifA (cid:12)= {2}. 4 Then,(Z ,+ ,τ)isanα -topologicalgroup,butitisnotaβ-α-topologicalgroup. 4 4 (β,β) Theorem 3.3. Let (G,+) be a group and τ be a topology on G. Then, (G,+,τ) is an α -topological group if and only if for any elements a,b of G and α -open set U (β,β) β witha−b ∈ U,thereexistα -opensetsV andW containinga andb respectivelysuch β thatV −W ⊆ U. Proof. Leta,b ∈ G,hencea−b ∈ G. LetU beanα -opensetcontaininga−b,then β there are α -open sets V containing a and R containing −b such that V +R ⊆ U, and β alsothereisanα -opensetW containingb suchthat−W ⊆ R. Hence,V −W ⊆ U. β Conversely, let a ∈ G and U be an α -open set containing −a. Then, U contains β theelement0−a andhencethereexistα -opensetsV containing0 andW containing β a such that V − W ⊆ U and −W = 0 − W ⊆ V − W ⊆ U. Now let a,b ∈ G and U ∈ αO(G,τ) such that a +b ∈ U. By hypothesis there exist α -open sets U and R β β containing a and −b respectively such that V −R ⊆ U and there is an α -open set W β containing b such that −W ⊆ R. Now, V +W = V +(−(−W)) ⊆ V +(−R) ⊆ U. Therefore,(G,+,τ)isanα -topologicalgroup. (cid:1) (β,β) Proposition 3.4. Let G be an α -topological abelian group, a ∈ G, B and C be (β,β) subsetsofG. Then,thefollowingstatementsaretrue: 1. The mappings f : G → G and f : G → G, where f(x) = −x and f (x) = a a x+a,arebothα -homeomorphismsfromthetopologicalspaceGontoitself. (β,β) 2. Thefollowingconditionsareequivalent: (a) B isα -open(α -closed). β β (b) −B isα -open(α -closed). β β (c) B +a isα -open(α -closed). β β 3. IfthesubsetB isα -open,thenB +C isalsoanα -open. β β 2296 AliasB.KhalafandHariwanZ.Ibrahim Proof. 1. Itisclearthatthemappingsf andf arebijective. a Let U be an α -open set in G containing f(x) = −x. Then, by G is an α - β (β,β) topological abelian group, there is V ∈ αO(G,τ) with x ∈ V and f(V) = β −V ⊆ U,thenf isα -continuous,soifU isα -open,thenf−1(U) = −U is (β,β) β α -open. β Let U be an α -open set in G containing f (x) = x + a. Then, by G is an β a α -topologicalabeliangroup,thereisV,W ∈ αO(G,τ) withx ∈ V,a ∈ W (β,β) β andf (V) = V +a ⊆ V +W ⊆ U,thenf isα -continuous. a a (β,β) Asfortheinversemappings,theirα -continuityisobviousbyvirtueoff−1 = (β,β) f andfa−1 = f−a. 2. (a) ⇒ (b) is obvious in view of the fact that −B = f(B). Since B + a = f (f(−B)), (b) ⇒ (c) is true. Finally, (c) ⇒ (a) follows from the fact that a B = (f )−1(B +a). a (cid:1) 3. Since B +C = (B +c), it follows that B +C is a union of α -open subsets β c∈C andhence,itisα -open. (cid:1) β Corollary 3.5. Let G be an α -topological abelian group and a ∈ G. A subset (β,β) U ⊆ Gisanα -neighborhoodoftheelementaifandonlyifU−aisanα -neighborhood β β of0. Proof. TheprooffollowsfromProposition3.4. (cid:1) Proposition3.6. LetBandCbesubsetsofanα -topologicalabeliangroupG. Then (β,β) thefollowingstatementsaretrue: 1. α Cl(B +C) ⊇ α Cl(B)+α Cl(C). β β β 2. α Cl(−B) = −α Cl(B). β β 3. α Cl(B −C) ⊇ α Cl(B)−α Cl(C). β β β Proof. 1. Letx ∈ α Cl(B)+α Cl(C)andletU beanα -opensetcontainingtheelementx. β β β Then,x = b+c,whereb ∈ α Cl(B)andc ∈ α Cl(C),and,hence,thereexistα - β β β opensetsV andW inGoftheelementsbandcrespectively,suchthatV+W ⊆ U. By virtue of the fact that V ∩B (cid:12)= φ and W ∩C (cid:12)= φ, elements b ∈ V ∩B and 1 c ∈ W ∩C can be found. Thus, b +c ∈ B +C and b +c ∈ V +W ⊆ U, 1 1 1 1 1 thatis(B +C)∩U (cid:12)= φ. Consequently,α Cl(B +C) ⊇ α Cl(B)+α Cl(C). β β β α -TopologicalAbelianGroups 2297 (β,β) 2. The validity of α Cl(−B) = −α Cl(B) results from the fact that the mapping β β x (cid:15)→ −x isanα -homeomorphismofthetopologicalspaceGontoitself(see (β,β) Proposition3.4(1)). 3. Inclusionα Cl(B −C) ⊇ α Cl(B)−α Cl(C)resultsfromitems(1)and(2). β β β (cid:1) Proposition3.7. LetGbeanα -topologicalabeliangroupandρ : αO(G×G) → (β,β) P(G×G)beanα-associatedoperationwithβandβ. Then,themappingmoftopological space G × G onto a topological space G, where m(a,b) = a + b for all a,b ∈ G, is α -continuous. (ρ,β) Proof. Let U be an α -open set in G containing m(x,y) = x +y. Since G is α - β (β,β) topologicalabeliangroup,thenthereareα -opensetsV containingxandW containingy β suchthatV +W ⊆ U,andalsothereareα-opensetsV containingx andW containing 1 1 y such that Vβ ⊆ V, Wβ ⊆ W and (V × W )ρ = Vβ × Wβ ⊆ V × W, implies 1 1 1 1 1 1 that m(V × W) = V + W ⊆ U and (x,y) ∈ V × W ∈ αO(G × G) , hence m is ρ α -continuous. (cid:1) (ρ,β) Definition3.8. AfamilyB ofsubsetsofanα -topologicalabeliangroupGiscalled x (β,β) a basis of α -neighborhoods of x ∈ G if any subset of B is an α -neighborhood of x β x β andanyα -neighborhoodoftheelementx containssomesubsetfromB . β x Proposition3.9. LetafamilyB ofsubsetsofanα -topologicalabeliangroupGbe 0 (β,β) a basis of α -neighborhoods of zero in G and β be an α-regular operation on αO(G). β Then,thefollowingconditionsaresatisfied: (cid:7) 1. 0 ∈ V. V∈B 0 2. For any subsets U and V from B , there exists a subset W ∈ B such that W ⊆ 0 0 U ∩V. 3. ForanysubsetU ∈ B ,thereexistsasubsetV ∈ B suchthatV +V ⊆ U. 0 0 4. ForanysubsetU ∈ B ,thereexistsasubsetV ∈ B suchthat−V ⊆ U. 0 0 Besides, if a ∈ G, then B = {a + V|V ∈ B } is a basis of α -neighborhoods of the a 0 β elementa. Proof. The fulfillment of conditions (1) and (2) results from the definition of a basis of α -neighborhoodsofanelementinatopologicalspace. β (3) Let U be any α -neighborhood of 0 = 0 + 0. Since G is an α -topological β (β,β) abeliangroup,thenthereareα -neighborhoodsW andW of0andW +W ⊆ U. Let β 1 2 1 2 V = W ∩W ,thenV isα -neighborhoodof0 andV +V ⊆ W +W ⊆ U. 1 2 β 1 2 2298 AliasB.KhalafandHariwanZ.Ibrahim Thefulfillmentofcondition(4)resultfromthedefinitionofanα -topologicalabelian (β,β) group. If a ∈ G, then the mapping f : G → G is an α -homeomorphism in view of a (β,β) Proposition 3.4, and, hence, B = {a + V|V ∈ B } = {f (V)|V ∈ B } is a basis of a 0 a 0 α -neighborhoodsoftheelementa. (cid:1) β Proposition 3.10. Let S be a subset of an α -topological abelian group G with a (β,β) (cid:7) basisB ofα -neighborhoodsofzero. Then,α Cl(S) = (S +V). 0 β β V∈B 0 (cid:6) (cid:6) (cid:6) Proof. Letx ∈ α Cl(S)andV ∈ B . LetalsoV ∈ B and−V ⊆ V,then(x +V )∩ β 0 0 (cid:6) S (cid:12)= φ,becausex ∈ α Cl(S). Then,x ∈ S−V ⊆ S+V. Therefore,α Cl(S) ⊆ S+V, β (cid:7) β and,hence,α Cl(S) ⊆ (S +V). β V(cid:7)∈B0 Conversely, let y ∈ (S + V), and let U be an α -neighborhood of zero in G. β V∈B 0 Let’schooseanα -neighborhoodV ∈ B ofzerosuchthat−V ⊆ U. Sincey ∈ S+V, β 0 (cid:7) thenS ∩(y +U) ⊇ S ∩(y −V) (cid:12)= φ,thatis (S +V) ⊆ α Cl(S). (cid:1) β V∈B 0 Proposition3.11. LetB beabasisofα -neighborhoodsofzeroofanα -topological 0(cid:7) β (β,β) abeliangroupG. Then, V isanα -closedset. β V∈B 0 (cid:7) Proof. By Proposition 3.10, we have V is an α -closure of a one element subset β V∈B 0 {0}inG. (cid:1) Corollary3.12. LetU andV beα -neighborhoodsofzeroofα -topologicalabelian β (β,β) groupGsuchthatV +V ⊆ U,thenα Cl(V) ⊆ U. β Proof. It is obvious that the family B of all α -neighborhoods of zero in G is a basis 0 β ofα -neighborhoodsofzeroofG. IntheviewofProposition3.10, β (cid:7) α Cl(V) = (V +W) ⊆ V +V ⊆ U. β W∈B 0 (cid:1) Proposition 3.13. Let G be an α -topological abelian group and β be an α-regular (β,β) operationonαO(G). Then,thefollowingstatementsaretrue: 1. G has a basis of α -neighborhoods of zero consisting of symmetric α -open β β neighborhoods. α -TopologicalAbelianGroups 2299 (β,β) 2. G has a basis of α -neighborhoods of zero consisting of symmetric α -closed β β neighborhoods. Proof. 1. LetB beabasisofα -neighborhoodsofzeroinG. ThenforeveryV ∈ B ,there 0 β 0 exists an α -open subset W in G such that 0 ∈ W ⊆ V. In view of Proposition β v v 3.4, the subset −W is α -open, besides, 0 ∈ −W . Hence, subset W ∩(−W ) v β v v v isanα -opensymmetricneighborhoodofzero,beingcontainedinV. Thenfrom β (cid:6) condition(2)ofProposition3.9,followsthatthefamilyB = {W ∩(−W )|V ∈ 0 v v B }isabasisofsymmetricα -openneighborhoodsofzeroinG. Thus,statement 0 β (1)isproved. (cid:6)(cid:6) (cid:6) 2. Let B = {α Cl(U)|U ∈ B }. From Proposition 3.6 and from the symmetry 0 β 0 (cid:6) of every α -neighborhood U ∈ B follows that −α Cl(U) = α Cl(−U) = β 0 β β (cid:6)(cid:6) α Cl(U). Hence, B is a family of symmetric α -closed neighborhoods of zero β 0 β (cid:6)(cid:6) of G. Let’s check that B is a basis of α -neighborhoods of zero in G. Indeed, 0 β (cid:6) if U ∈ B , then, in view of condition (3) of Proposition 3.9, there exists an α - 0 β (cid:6) (cid:6) (cid:6) (cid:6) neighborhoodU ∈ B suchthatU +U ⊆ U. Consequently,inviewofCorollary 0 (cid:6) (cid:6)(cid:6) 3.12,α Cl(U ) ⊆ U,and,hence,B isabasisofα -neighborhoodsofzeroinG. β 0 β (cid:1) Corollary 3.14. Let G be an α -topological abelian group, a ∈ G and β be an (β,β) α-regularoperationonαO(G). Then,thefollowingstatementsaretrue: 1. The element a has a basis of α -neighborhoods consisting of α -open neighbor- β β hoods. 2. Theelementahasabasisofα -neighborhoodsconsistingofα -closedneighbor- β β hoods. Proof. FollowsfromProposition3.13andProposition3.4. (cid:1) Theorem3.15. Foranyα -topologicalabeliangroupGandβanα-regularoperation (β,β) onαO(G),thefollowingconditionsareequivalent: 1. Gisanα T -space. β 2 2. {0}isα -closedsubsetinG. β (cid:7) 3. IfB isabasisofα -neighborhoodsofzeroofG,then V = {0}. 0 β V∈B 0 4. Gisanα T -space. β 0 2300 AliasB.KhalafandHariwanZ.Ibrahim 5. Gisanα T -space. β 1 Proof. (1) ⇒ (2): If 0 (cid:12)= a ∈ α Cl({0}), then due to item (1), there exist α -open sets β β U and V containing a and 0 respectively such that U ∩ V = φ. In particular, 0 ∈/ U, thatisU ∩{0} =φ ,thatcontradictsthefactthata ∈ α Cl({0}). β (2) ⇒ (3): Let{0}beα -closedsubsetinGandB beabasisof α -neighborhoodsof β 0 β (cid:7) zero in G. Then, due to Proposition 3.10, we get {0} =α Cl({0}) = ({0}+V) = β (cid:7) V∈B0 V. V∈B0 (cid:7) (3) ⇒ (4): LetB beabasisofα -neighborhoodsofzeroinG,and V = {0}. Let 0 β V∈B 0 x,y ∈ G and x (cid:12)= y, then x −y (cid:12)= 0, hence, there exists an α -neighborhood V ∈ B β 0 0 suchthatx −y ∈/ V . Therefore,x ∈/ y +V . Thus,Gisα T -space. 0 0 β 0 (4) ⇒ (5): Let G be an α T -space and x,y be distinct elements of G. Then there β 0 existsanα -opensubsetV suchthat: β Case 1. 0 ∈ V,−x + y ∈/ V. Let U be a symmetric α -neighborhood of 0 such that β U +U ⊆ V. Then−x +y ∈/ U +U,hencex +U ∩y +U = φ. Case2. 0 ∈/ V,−x+y ∈ V,then0 ∈ −y+x+V,and−y+x ∈/ −y+x+V = W. LetW 1 beasymmetricα -neighborhoodof0suchthatW +W ⊆ W. Then−y+x ∈/ W +W , β 1 1 1 1 hencex +W ∩y +W = φ. 1 1 Thus,Gisα T -space. β 1 (5) ⇒ (1): Let x,y ∈ X such that x − y (cid:12)= 0. Then there exists an α -open set β U containing 0 such that x − y ∈/ U. Then, there exists symmetric α -open set W β containing 0 such that W + W ⊆ U. Let V = x + W and V = y + W and note 1 2 that V ∈ αO(G,x) , V ∈ αO(G,y) and V ∩ V = φ, since if a ∈ V ∩ V , then 1 β 2 β 1 2 1 2 −(a−x) ∈ W anda−y ∈ W. Itfollowsthatx−y = (a−y)+(−(a−x)) ∈ W+W ⊆ U, whichisacontradiction. So,wehaveV ∩V = φ. Therefore,Gisα-β-T . (cid:1) 1 2 2 Definition3.16. Let(G,+,τ)beanα -topologicalabeliangroup. AsubsetB ofG (β,β) iscalledasubgroupofα -topologicalgroup(G,τ)ifB isasubgroupofGandB is (β,β) endowedwithfamilyαO(G) |B inducedbytheαO(G) . β β Theorem 3.17. Let B be a subgroup of an α -topological group (G,+,τ). Then (β,β) (B,+,αO(G) |B)isatopologicalgroup. β Proof. Let b ,b ∈ B and U ∈ αO(G) |B with b − b ∈ U. Then U = U ∩ B, 1 2 β 1 2 1 (cid:6) (cid:6)(cid:6) where U ∈ αO(G) and b −b ∈ U . Let V and V be α -open sets containing b β 1 2 1 1 1 β 1 (cid:6) (cid:6)(cid:6) (cid:6) (cid:6) (cid:6)(cid:6) (cid:6)(cid:6) and b respectively such that V −V ⊆ U . Then V = V ∩B and V = V ∩B are 2 1 1 1 1 1 (cid:6) (cid:6)(cid:6) (cid:6) (cid:6)(cid:6) inαO(G) |B containingb andb respectively. Besides,V −V ⊆ (V −V )∩B ⊆ β 1 2 1 1